missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
BOC-L-Aspartic acid 4-benzylester, 99+%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 275520050
Specifications
| 98°C to 102°C | |
| 7536-58-5 | |
| 99+% | |
| Authentic | |
| MFCD00065564 | |
| boc-asp obzl-oh, boc-l-aspartic acid 4-benzyl ester, s-4-benzyloxy-2-tert-butoxycarbonyl amino-4-oxobutanoic acid, boc-l-asp obzl-oh, boc-l-aspartic acid-4-benzyl ester, 4-benzyl n-boc-l-aspartate, boc-l-aspartic acid 4-benzylester, 2s-4-benzyloxy-2-tert-butoxycarbonyl amino-4-oxobutanoic acid, boc-aspartic acid beta-benzyl ester, n-tert-butoxycarbonyl-l-aspartic acid 4-benzyl ester | |
| CC(C)(C)OC(=O)NC(CC(=O)OCC1=CC=CC=C1)C(=O)O | |
| -18.5° to -21° (20°C, 589nm) (c=2, DMF) | |
| 1581888 | |
| ≥99.0% | |
| Powder |
| BOC-L-Aspartic acid 4-benzylester | |
| White | |
| C16H21NO6 | |
| C6H5CH2OCOCH2CH(COOH)nHCOOC(CH3)3 | |
| Glass Bottle | |
| SOHLZANWVLCPHK-LBPRGKRZSA-N | |
| (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-phenylmethoxybutanoic acid | |
| 323.345 | |
| 323.34 | |
| 5 g |
Chemical Identifiers
| 7536-58-5 | |
| 323.345 | |
| SOHLZANWVLCPHK-LBPRGKRZSA-N | |
| 1581888 | |
| CC(C)(C)OC(=O)NC(CC(=O)OCC1=CC=CC=C1)C(=O)O |
| C16H21NO6 | |
| MFCD00065564 | |
| boc-asp obzl-oh, boc-l-aspartic acid 4-benzyl ester, s-4-benzyloxy-2-tert-butoxycarbonyl amino-4-oxobutanoic acid, boc-l-asp obzl-oh, boc-l-aspartic acid-4-benzyl ester, 4-benzyl n-boc-l-aspartate, boc-l-aspartic acid 4-benzylester, 2s-4-benzyloxy-2-tert-butoxycarbonyl amino-4-oxobutanoic acid, boc-aspartic acid beta-benzyl ester, n-tert-butoxycarbonyl-l-aspartic acid 4-benzyl ester | |
| (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-phenylmethoxybutanoic acid |
RUO – Research Use Only