missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
BOC-L-Aspartic acid 4-benzylester, 99+%, ACROS Organics™
Manufacturer: Thermo Fisher Scientific 275520050
Specifications
BOC-L-Aspartic acid 4-benzylester | |
99+% | |
C6H5CH2OCOCH2CH(COOH)nHCOOC(CH3)3 | |
MFCD00065564 | |
Glass bottle | |
CC(C)(C)OC(=O)NC(CC(=O)OCC1=CC=CC=C1)C(=O)O | |
323.345 | |
323.34 | |
Powder | |
White | |
5g |
7536-58-5 | |
C16H21NO6 | |
Authentic | |
2s-4-benzyloxy-2-tert-butoxycarbonyl amino-4-oxobutanoic acid, 4-benzyl n-boc-l-aspartate, boc-asp obzl-oh, boc-aspartic acid beta-benzyl ester, boc-l-asp obzl-oh, boc-l-aspartic acid 4-benzyl ester, boc-l-aspartic acid 4-benzylester, boc-l-aspartic acid-4-benzyl ester, n-tert-butoxycarbonyl-l-aspartic acid 4-benzyl ester, s-4-benzyloxy-2-tert-butoxycarbonyl amino-4-oxobutanoic acid | |
SOHLZANWVLCPHK-LBPRGKRZSA-N | |
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-phenylmethoxybutanoic acid | |
1581888 | |
-18.5° to -21° (20°C, 589nm) (c=2, DMF) | |
≥99.0% | |
98°C to 102°C |
Chemical Identifiers
7536-58-5 | |
323.345 | |
SOHLZANWVLCPHK-LBPRGKRZSA-N | |
1581888 | |
CC(C)(C)OC(=O)NC(CC(=O)OCC1=CC=CC=C1)C(=O)O |
C16H21NO6 | |
MFCD00065564 | |
2s-4-benzyloxy-2-tert-butoxycarbonyl amino-4-oxobutanoic acid, 4-benzyl n-boc-l-aspartate, boc-asp obzl-oh, boc-aspartic acid beta-benzyl ester, boc-l-asp obzl-oh, boc-l-aspartic acid 4-benzyl ester, boc-l-aspartic acid 4-benzylester, boc-l-aspartic acid-4-benzyl ester, n-tert-butoxycarbonyl-l-aspartic acid 4-benzyl ester, s-4-benzyloxy-2-tert-butoxycarbonyl amino-4-oxobutanoic acid | |
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-phenylmethoxybutanoic acid |