missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Bis(trimethylsilyl) malonate, 98%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 313300100
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| Bis(trimethylsilyl) malonate | |
| 0.9720g/mL | |
| 23°C | |
| 96% min. (GC) | |
| C9H20O4Si2 | |
| (CH3)3SiOC(O)CH2C(O)OSi(CH3)3 | |
| 10g | |
| bis trimethylsilyl malonate, malonic acid bis trimethylsilyl ester, propanedioic acid, bis trimethylsilyl ester, malonic acid, bis trimethylsilyl ester, malonic acid ditms, malonic acid 2tms, malonic acid, bis-tms, bis trimethylsilyl malonat, malonic acid bis-tms, acmc-1c3vy | |
| ATCKJLDGNXGLAO-UHFFFAOYSA-N | |
| bis(trimethylsilyl) propanedioate | |
| 87656 | |
| 98% |
| 18457-04-0 | |
| 63°C to 66°C (1.0mmHg) | |
| Authentic | |
| Glass bottle | |
| 1.4150 to 1.417 | |
| MFCD00009631 | |
| 0.972 | |
| Solubility in water: reacts | |
| C[Si](C)(C)OC(=O)CC(=O)O[Si](C)(C)C | |
| 248.43 | |
| 248.43 |
Chemical Identifiers
| 18457-04-0 | |
| 248.43 | |
| ATCKJLDGNXGLAO-UHFFFAOYSA-N | |
| 87656 | |
| C[Si](C)(C)OC(=O)CC(=O)O[Si](C)(C)C |
| C9H20O4Si2 | |
| MFCD00009631 | |
| bis trimethylsilyl malonate, malonic acid bis trimethylsilyl ester, propanedioic acid, bis trimethylsilyl ester, malonic acid, bis trimethylsilyl ester, malonic acid ditms, malonic acid 2tms, malonic acid, bis-tms, bis trimethylsilyl malonat, malonic acid bis-tms, acmc-1c3vy | |
| bis(trimethylsilyl) propanedioate |
Safety and Handling
GHS H Statement
Flammable liquid and vapor.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
GHS Signal Word: Warning
EINECSNumber : 242-342-5
RUO â Research Use Only