missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Bis(2-ethylhexyl) sebacate, 97%, Thermo Scientific Chemicals
Supplier: Thermo Scientific Chemicals 269920025
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Bis(2-ethylhexyl) sebacate | |
| 0.15mg KOH/g max. | |
| Yellow | |
| 212°C (1.0 mmHg) | |
| Authentic | |
| Glass bottle | |
| 1.4500 to 1.455 | |
| 2.5 L | |
| 02,181 | |
| 0.91 | |
| bis 2-ethylhexyl sebacate, bisoflex, bis 2-ethylhexyl decanedioate, plexol, bisoflex dos, monoplex dos, octoil s, reolube dos, staflex dos, di 2-ethylhexyl sebacate | |
| VJHINFRRDQUWOJ-UHFFFAOYNA-N | |
| bis(2-ethylhexyl) decanedioate | |
| 31218 | |
| 426.67 | |
| Liquid |
| 122-62-3 | |
| -55°C | |
| 0.9100g/mL | |
| 215°C | |
| 96% min. (GC) | |
| C26H50O4 | |
| MFCD00009497 | |
| 260 to 265mg KOH/g | |
| 12% (10g, 6 hrs, 200°C) max. | |
| 15,1255 | |
| Solubility in water: insoluble | |
| CCCCC(CC)COC(=O)CCCCCCCCC(=O)OCC(CC)CCCC | |
| 426.68 | |
| ca 23 mPa.s (20°C) | |
| 97% |
Chemical Identifiers
| 122-62-3 | |
| 426.68 | |
| VJHINFRRDQUWOJ-UHFFFAOYNA-N | |
| 31218 | |
| CCCCC(CC)COC(=O)CCCCCCCCC(=O)OCC(CC)CCCC |
| C26H50O4 | |
| MFCD00009497 | |
| bis 2-ethylhexyl sebacate, bisoflex, bis 2-ethylhexyl decanedioate, plexol, bisoflex dos, monoplex dos, octoil s, reolube dos, staflex dos, di 2-ethylhexyl sebacate | |
| bis(2-ethylhexyl) decanedioate |
Safety and Handling
EINECSNumber : 204-558-8
RUO – Research Use Only