missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Benzyltrimethylammonium chloride, 50 wt.% solution in water, ACROS Organics™
$38.27 - $173.84
Chemical Identifiers
| CAS | 56-93-9 |
|---|---|
| Molecular Formula | C10H16ClN |
| Molecular Weight (g/mol) | 185.70 |
| MDL Number | MFCD00011782 |
| InChI Key | KXHPPCXNWTUNSB-UHFFFAOYSA-M |
| Synonym | ammonium, benzyltrimethyl-, chloride, benzenemethanaminium, n,n,n-trimethyl-, chloride, benzyl trimethyl ammonium chloride, benzyl trimethylammonium chloride, benzyltrimethyl ammonium chloride, benzyltrimethylammonium chloride, benzyltrimethylazanium chloride, tmbac, trimethylbenzylammonium chloride, unii-vnk45y7ba1 |
| PubChem CID | 5963 |
| IUPAC Name | benzyl(trimethyl)azanium;chloride |
| SMILES | [Cl-].C[N+](C)(C)CC1=CC=CC=C1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC209381000
|
Thermo Fisher Scientific
209381000 |
100g | Glass bottle |
Each for $38.27
|
|
AC209380010
|
Thermo Fisher Scientific
AC209380010 |
1kg | Glass bottle |
Each for $173.84
|
|
Description
Phase transfer catalystChemical Identifiers
| 56-93-9 | |
| 185.70 | |
| KXHPPCXNWTUNSB-UHFFFAOYSA-M | |
| 5963 | |
| [Cl-].C[N+](C)(C)CC1=CC=CC=C1 |
| C10H16ClN | |
| MFCD00011782 | |
| ammonium, benzyltrimethyl-, chloride, benzenemethanaminium, n,n,n-trimethyl-, chloride, benzyl trimethyl ammonium chloride, benzyl trimethylammonium chloride, benzyltrimethyl ammonium chloride, benzyltrimethylammonium chloride, benzyltrimethylazanium chloride, tmbac, trimethylbenzylammonium chloride, unii-vnk45y7ba1 | |
| benzyl(trimethyl)azanium;chloride |
Specifications
| 56-93-9,7732-18-5 | |
| 51.0,51.0 | |
| C6H5CH2N(CH3)3Cl | |
| 12, 1020 | |
| 1.0440g/mL | |
| KXHPPCXNWTUNSB-UHFFFAOYSA-M | |
| benzyl(trimethyl)azanium;chloride | |
| 5963 | |
| Liquid | |
| Glass bottle | |
| 1.044 | |
| 100g |
| 49.0,49.0 | |
| C10H16ClN | |
| MFCD00011782 | |
| 01,53 | |
| ammonium, benzyltrimethyl-, chloride, benzenemethanaminium, n,n,n-trimethyl-, chloride, benzyl trimethyl ammonium chloride, benzyl trimethylammonium chloride, benzyltrimethyl ammonium chloride, benzyltrimethylammonium chloride, benzyltrimethylazanium chloride, tmbac, trimethylbenzylammonium chloride, unii-vnk45y7ba1 | |
| [Cl-].C[N+](C)(C)CC1=CC=CC=C1 | |
| 185.70 | |
| 185.7 | |
| ≥49% | |
| 1.445 | |
| Colorless to Yellow | |
| Benzyltrimethylammonium chloride, 50 wt. % Solution in Water |
Safety and Handling
GHS P Statement Toxic if swallowed. Toxic in contact with skin. Harmful if inhaled. Suspected of causing genetic defects. Harmful to aquatic life with long lasting effects.
GHS P Statement Wear protective gloves/protective clothing/eye protection/face protection. IF exposed: Call a POISON CENTRE or doctor/physician. Avoid release to the environment.
Danger
EINECSNumber : 200-300-3
RTECSNumber : BO8400000
TSCA : TSCA