Learn More
Benzil, 99+%, Thermo Scientific™
$41.62 - $114.69
Chemical Identifiers
| CAS | 134-81-6 |
|---|---|
| Molecular Formula | C14H10O2 |
| Molecular Weight (g/mol) | 210.23 |
| MDL Number | MFCD00003080 |
| InChI Key | WURBFLDFSFBTLW-UHFFFAOYSA-N |
| Synonym | 1,2-diphenylethanedione, benzil, bibenzoyl, dibenzoyl, diphenyldiketon, diphenylethane-1,2-dione, diphenylethanedione, diphenylglyoxal, ethanedione, diphenyl, glyoxal, diphenyl |
| PubChem CID | 8651 |
| ChEBI | CHEBI:51507 |
| IUPAC Name | 1,2-diphenylethane-1,2-dione |
| SMILES | O=C(C(=O)C1=CC=CC=C1)C1=CC=CC=C1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC105411000
|
Fisher Scientific Acros
105411000 |
100g | Plastic bottle |
Each for $41.62
|
|
AC105415000
|
Fisher Scientific Acros
105415000 |
500g | Plastic bottle |
Each for $114.69
|
|
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 134-81-6 | |
| 210.23 | |
| WURBFLDFSFBTLW-UHFFFAOYSA-N | |
| 8651 | |
| 1,2-diphenylethane-1,2-dione |
| C14H10O2 | |
| MFCD00003080 | |
| 1,2-diphenylethanedione, benzil, bibenzoyl, dibenzoyl, diphenyldiketon, diphenylethane-1,2-dione, diphenylethanedione, diphenylglyoxal, ethanedione, diphenyl, glyoxal, diphenyl | |
| CHEBI:51507 | |
| O=C(C(=O)C1=CC=CC=C1)C1=CC=CC=C1 |
Specifications
| 134-81-6 | |
| 100.0 | |
| 94.0°C to 97.0°C | |
| 0.5% max. | |
| C14H10O2 | |
| C6H5COCOC6H5 | |
| Plastic bottle | |
| 100g | |
| Solubility in water: 0.5g/L (20°C). Other solubilities: soluble in alcohol,ether,chloroform,ethyl,acetate,benzene,toluene and nitrobenzene | |
| O=C(C(=O)C1=CC=CC=C1)C1=CC=CC=C1 | |
| 210.23 | |
| CHEBI:51507 | |
| Crystalline Powder | |
| 0.1% max. |
| 99.0 | |
| White | |
| 346.0°C to 348.0°C | |
| 99% min. (GC) | |
| Authentic | |
| MFCD00003080 | |
| 15,108 | |
| 1,2-diphenylethanedione, benzil, bibenzoyl, dibenzoyl, diphenyldiketon, diphenylethane-1,2-dione, diphenylethanedione, diphenylglyoxal, ethanedione, diphenyl, glyoxal, diphenyl | |
| WURBFLDFSFBTLW-UHFFFAOYSA-N | |
| 1,2-diphenylethane-1,2-dione | |
| 8651 | |
| 210.23 | |
| 99+% | |
| Benzil, 99+% |
Safety and Handling
GHS H Statement
Causes serious eye irritation.
Causes skin irritation.
GHS P Statement
IF ON SKIN: Wash with plenty of soap and water.
If eye irritation persists: Get medical advice/attention.
IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing.
GHS Signal Word: Warning
EINECSNumber : 205-157-0
RTECSNumber : DD1925000
TSCA : TSCA
RUO – Research Use Only