missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Benzil, 99+%, ACROS Organics™
$37.36 - $104.58
Chemical Identifiers
| CAS | 134-81-6 |
|---|---|
| Molecular Formula | C14H10O2 |
| Molecular Weight (g/mol) | 210.23 |
| MDL Number | MFCD00003080 |
| InChI Key | WURBFLDFSFBTLW-UHFFFAOYSA-N |
| Synonym | 1,2-diphenylethanedione, benzil, bibenzoyl, dibenzoyl, diphenyldiketon, diphenylethane-1,2-dione, diphenylethanedione, diphenylglyoxal, ethanedione, diphenyl, glyoxal, diphenyl |
| PubChem CID | 8651 |
| ChEBI | CHEBI:51507 |
| IUPAC Name | 1,2-diphenylethane-1,2-dione |
| SMILES | C1=CC=C(C=C1)C(=O)C(=O)C2=CC=CC=C2 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC105411000
|
Fisher Scientific Acros
105411000 |
100g | Plastic bottle |
Each for $37.36
|
|
AC105415000
|
Fisher Scientific Acros
105415000 |
500g | Plastic bottle |
Each for $104.58
|
|
AC105410025
|
Thermo Fisher Scientific
AC105410025 |
2.5kg | Plastic bottle | N/A | N/A |
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
Chemical Identifiers
| 134-81-6 | |
| 210.23 | |
| WURBFLDFSFBTLW-UHFFFAOYSA-N | |
| 8651 | |
| 1,2-diphenylethane-1,2-dione |
| C14H10O2 | |
| MFCD00003080 | |
| 1,2-diphenylethanedione, benzil, bibenzoyl, dibenzoyl, diphenyldiketon, diphenylethane-1,2-dione, diphenylethanedione, diphenylglyoxal, ethanedione, diphenyl, glyoxal, diphenyl | |
| CHEBI:51507 | |
| C1=CC=C(C=C1)C(=O)C(=O)C2=CC=CC=C2 |
Specifications
| Authentic | |
| Plastic bottle | |
| 346.0°C to 348.0°C | |
| 94.0°C to 97.0°C | |
| 134-81-6 | |
| 100.0 | |
| C14H10O2 | |
| MFCD00003080 | |
| 1,2-diphenylethanedione, benzil, bibenzoyl, dibenzoyl, diphenyldiketon, diphenylethane-1,2-dione, diphenylethanedione, diphenylglyoxal, ethanedione, diphenyl, glyoxal, diphenyl | |
| WURBFLDFSFBTLW-UHFFFAOYSA-N | |
| 1,2-diphenylethane-1,2-dione | |
| 8651 | |
| 210.23 | |
| 99+% |
| 0.5% max. | |
| 0.1% max. | |
| White | |
| 100g | |
| 99.0 | |
| 99% min. (GC) | |
| C6H5COCOC6H5 | |
| 15,108 | |
| Solubility in water: 0.5g/L (20°C). Other solubilities: soluble in alcohol,ether,chloroform,ethyl,acetate,benzene,toluene and nitrobenzene | |
| C1=CC=C(C=C1)C(=O)C(=O)C2=CC=CC=C2 | |
| 210.23 | |
| CHEBI:51507 | |
| Crystalline Powder | |
| Benzil, 99+% |
Safety and Handling
GHS H Statement
Causes serious eye irritation.
Causes skin irritation.
GHS P Statement
IF ON SKIN: Wash with plenty of soap and water.
If eye irritation persists: Get medical advice/attention.
IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing.
GHS Signal Word: Warning
EINECSNumber : 205-157-0
RTECSNumber : DD1925000
TSCA : TSCA