missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Adenosine, 99.8%, MP Biomedicals™
A nucleotide resulting from the union of one molecule of sugar -- d-ribose -- with a base, l-adenine
Supplier: MP Biomedicals Inc 0210019905
Specifications
| Adenosine | |
| White | |
| 99.80% | |
| MFCD00005752 | |
| adenosine, adenocard, adenoscan, adenine riboside, adenosin, beta-d-adenosine, nucleocardyl, boniton, sandesin, myocol | |
| NC1=C2N=CN([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)C2=NC=N1 | |
| 267.25 | |
| CHEBI:16335 | |
| Crystalline Powder |
| 58-61-7 | |
| 2.09g/cm3 | |
| C10H13N5O4 | |
| 5 g | |
| OIRDTQYFTABQOQ-KQYNXXCUSA-N | |
| (2R,3R,4S,5R)-2-(6-amino-9H-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol | |
| 60961 | |
| 267.2 |
Chemical Identifiers
| 58-61-7 | |
| 267.25 | |
| OIRDTQYFTABQOQ-KQYNXXCUSA-N | |
| 60961 | |
| NC1=C2N=CN([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)C2=NC=N1 |
| C10H13N5O4 | |
| MFCD00005752 | |
| adenosine, adenocard, adenoscan, adenine riboside, adenosin, beta-d-adenosine, nucleocardyl, boniton, sandesin, myocol | |
| CHEBI:16335 |
Safety and Handling
EINECSNumber : 200-389-9