missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Adenosine 5'-monophosphate sodium salt, 99%, ACROS Organics™
Manufacturer: Acros Organics AC440710050
Specifications
| Adenosine 5′-monophosphate sodium salt hydrate | |
| 98.5 | |
| 99% | |
| sodium 2r,3s,4r,5r-5-6-amino-9h-purin-9-yl-3,4-dihydroxytetrahydrofuran-2-yl methyl phosphate hydrate x:1:x, adenosine 5-monophosphoric acid disodium salt, adenosine 5'-monophosphate sodium salt, sodium 2r,3s,4r,5r-5-6-amino-9h-purin-9-yl-3,4-dihydroxytetrahydrofuran-2-yl methyl phosphate hydrate, pubchem14181, sodium 2r,3s,4r,5r-5-6-amino-9h-purin-9-yl-3,4-dihydroxytetrahydrofuran-2-yl methyl phosphate hydrate 2:1:x, 5'-adenylic acid,sodium salt, hydrate 9ci, disodium hydrate adenosine-5-monophosphate 2- | |
| C1=NC2=C(C(=N1)N)N=CN2C3C(C(C(O3)COP(=O)(O)[O-])O)O.[Na+] | |
| 369.206 | |
| 369.21 | |
| 99% | |
| Glass bottle | |
| White | |
| 5g |
| 149022-20-8 | |
| 100.0 | |
| C10H13N5NaO7P | |
| FYWLYWMEGHCZAX-MCDZGGTQSA-M | |
| sodium;[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate | |
| 23674992 | |
| Powder | |
| Authentic | |
| 20% Max. | |
| 4.50 to 6.50 |
Chemical Identifiers
| 149022-20-8 | |
| 369.206 | |
| sodium 2r,3s,4r,5r-5-6-amino-9h-purin-9-yl-3,4-dihydroxytetrahydrofuran-2-yl methyl phosphate hydrate x:1:x, adenosine 5-monophosphoric acid disodium salt, adenosine 5'-monophosphate sodium salt, sodium 2r,3s,4r,5r-5-6-amino-9h-purin-9-yl-3,4-dihydroxytetrahydrofuran-2-yl methyl phosphate hydrate, pubchem14181, sodium 2r,3s,4r,5r-5-6-amino-9h-purin-9-yl-3,4-dihydroxytetrahydrofuran-2-yl methyl phosphate hydrate 2:1:x, 5'-adenylic acid,sodium salt, hydrate 9ci, disodium hydrate adenosine-5-monophosphate 2- | |
| sodium;[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate |
| C10H13N5NaO7P | |
| FYWLYWMEGHCZAX-MCDZGGTQSA-M | |
| 23674992 | |
| C1=NC2=C(C(=N1)N)N=CN2C3C(C(C(O3)COP(=O)(O)[O-])O)O.[Na+] |