missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Acid Fuchsin, pure, high purity biological stain, ACROS Organics™
$91.23 - $284.84
Chemical Identifiers
| CAS | 3244-88-0 |
|---|---|
| Molecular Formula | C20H19N3Na2O9S3 |
| Molecular Weight (g/mol) | 587.544 |
| MDL Number | MFCD00013286 |
| InChI Key | VCEFFPMSOGDMJX-UHFFFAOYSA-N |
| Synonym | Acid Violet 19, C.I. 42685, Fuchsin Acid, Rubin S, Rubin S |
| PubChem CID | 131852436 |
| IUPAC Name | 3-[bis(4-amino-3-sulfophenyl)methylidene]-6-imino-5-methylcyclohexa-1,4-diene-1-sulfonic acid;sodium |
| SMILES | CC1=CC(=C(C2=CC(=C(C=C2)N)S(=O)(=O)O)C3=CC(=C(C=C3)N)S(=O)(=O)O)C=C(C1=N)S(=O)(=O)O.[Na].[Na] |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
| AC227901000 SDS |
Acros Organics
227901000 |
100g | Glass bottle |
Each for $284.84
|
|
AC227900250 SDS |
Acros Organics
227900250 |
25g | Glass bottle |
Each for $91.23
|
|
AC227905000 SDS |
Acros Organics
AC227905000 |
500g | Glass bottle | N/A | N/A |
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
Chemical Identifiers
| 3244-88-0 | |
| 587.544 | |
| VCEFFPMSOGDMJX-UHFFFAOYSA-N | |
| 131852436 | |
| CC1=CC(=C(C2=CC(=C(C=C2)N)S(=O)(=O)O)C3=CC(=C(C=C3)N)S(=O)(=O)O)C=C(C1=N)S(=O)(=O)O.[Na].[Na] |
| C20H19N3Na2O9S3 | |
| MFCD00013286 | |
| Acid Violet 19, C.I. 42685, Fuchsin Acid, Rubin S, Rubin S | |
| 3-[bis(4-amino-3-sulfophenyl)methylidene]-6-imino-5-methylcyclohexa-1,4-diene-1-sulfonic acid;sodium |
Specifications
| 3244-88-0 | |
| C20H19N3Na2O9S3 | |
| Acid Violet 19, C.I. 42685, Fuchsin Acid, Rubin S, Rubin S | |
| Authentic | |
| 3-[bis(4-amino-3-sulfophenyl)methylidene]-6-imino-5-methylcyclohexa-1,4-diene-1-sulfonic acid;sodium | |
| 544 to 550nm (in pH 3 acidified water) | |
| 585.52 | |
| Pure | |
| Solubility in water: 143g/L. Other solubilities: slightly soluble in alcohol | |
| Green | |
| Acid Fuchsin |
| 1 to 1.4 | |
| MFCD00013286 | |
| VCEFFPMSOGDMJX-UHFFFAOYSA-N | |
| CC1=CC(=C(C2=CC(=C(C=C2)N)S(=O)(=O)O)C3=CC(=C(C=C3)N)S(=O)(=O)O)C=C(C1=N)S(=O)(=O)O.[Na].[Na] | |
| 587.544 | |
| 131852436 | |
| Powder or Crystals | |
| Glass bottle | |
| 700 (at lambda min.) | |
| 100g |
Safety and Handling
EINECSNumber : 221-816-5
RTECSNumber : DD4737000
TSCA : TSCA