missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
7-Diethylamino-4-methylcoumarin, 99%, ACROS Organics™
Manufacturer: Thermo Fisher Scientific AC114051000
Specifications
| 7-Diethylamino-4-methylcoumarin | |
| Plastic bottle | |
| 70°C to 73°C | |
| 99% | |
| 98.5 | |
| 99% | |
| MFCD00006864 | |
| Solubility in water: slightly soluble. Other solubilities: soluble in aqueous acid solutions,soluble in nearly all common organic solvents,slightly soluble in aliphatic hydrocarbons | |
| CCN(CC)C1=CC2=C(C=C1)C(=CC(=O)O2)C | |
| 231.29 | |
| CHEBI:51938 | |
| Crystalline Powder | |
| Pure |
| Authentic | |
| Beige to Purple | |
| 100g | |
| 91-44-1 | |
| 100.0 | |
| C14H17NO2 | |
| 4-methyl-7-diethylamino coumarin, 4-methyl-7-diethylaminocoumarin, 7-diethylamino-4-methyl-2h-chromen-2-one, 7-diethylamino-4-methylcoumarin, blancophor aw, blancophor ffg, coumarin 1, coumarin 460, coumarin 47, hakkol p | |
| AFYCEAFSNDLKSX-UHFFFAOYSA-N | |
| 7-(diethylamino)-4-methylchromen-2-one | |
| 7050 | |
| 231.29 | |
| 99% |
Chemical Identifiers
| 91-44-1 | |
| 231.29 | |
| AFYCEAFSNDLKSX-UHFFFAOYSA-N | |
| 7050 | |
| 7-(diethylamino)-4-methylchromen-2-one |
| C14H17NO2 | |
| MFCD00006864 | |
| 4-methyl-7-diethylamino coumarin, 4-methyl-7-diethylaminocoumarin, 7-diethylamino-4-methyl-2h-chromen-2-one, 7-diethylamino-4-methylcoumarin, blancophor aw, blancophor ffg, coumarin 1, coumarin 460, coumarin 47, hakkol p | |
| CHEBI:51938 | |
| CCN(CC)C1=CC2=C(C=C1)C(=CC(=O)O2)C |
Safety and Handling
EINECSNumber : 202-068-9
RTECSNumber : GN6370000
TSCA : TSCA