Learn More
Alfa Aesar™ 6-Bromoindole-2-carboxylic acid, 97%
$53.66 - $703.20
Chemical Identifiers
| CAS | 16732-65-3 |
|---|---|
| Molecular Formula | C9H6BrNO2 |
| Molecular Weight (g/mol) | 240.056 |
| MDL Number | MFCD02664469 |
| InChI Key | SVBVYRYROZWKNJ-UHFFFAOYSA-N |
| Synonym | 6-bromoindole-2-carboxylic acid, 6-bromo-2-indolecarboxylic acid, 1h-indole-2-carboxylic acid, 6-bromo, 6-bromoindole-2-carboxylicacid, zlchem 475, pubchem1664, acmc-1bqkh, intermediates-zcf02255, evoblocks eb21020, timtec-bb sbb014280 |
| PubChem CID | 4011696 |
| IUPAC Name | 6-bromo-1H-indole-2-carboxylic acid |
| SMILES | C1=CC2=C(C=C1Br)NC(=C2)C(=O)O |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
| AAH63799MD |
Alfa Aesar™
H63799MD |
250mg |
Each for $53.66
|
|
AAH6379903 |
Alfa Aesar™
H6379903 |
1g |
Each for $171.18
|
|
AAH6379906 |
Alfa Aesar™
H6379906 |
5g |
Each for $703.20
|
|
Chemical Identifiers
| 16732-65-3 | |
| 240.056 | |
| SVBVYRYROZWKNJ-UHFFFAOYSA-N | |
| 4011696 | |
| C1=CC2=C(C=C1Br)NC(=C2)C(=O)O |
| C9H6BrNO2 | |
| MFCD02664469 | |
| 6-bromoindole-2-carboxylic acid, 6-bromo-2-indolecarboxylic acid, 1h-indole-2-carboxylic acid, 6-bromo, 6-bromoindole-2-carboxylicacid, zlchem 475, pubchem1664, acmc-1bqkh, intermediates-zcf02255, evoblocks eb21020, timtec-bb sbb014280 | |
| 6-bromo-1H-indole-2-carboxylic acid |
Specifications
| 250mg | |
| C9H6BrNO2 | |
| 6-bromoindole-2-carboxylic acid, 6-bromo-2-indolecarboxylic acid, 1h-indole-2-carboxylic acid, 6-bromo, 6-bromoindole-2-carboxylicacid, zlchem 475, pubchem1664, acmc-1bqkh, intermediates-zcf02255, evoblocks eb21020, timtec-bb sbb014280 | |
| C1=CC2=C(C=C1Br)NC(=C2)C(=O)O | |
| 240.056 | |
| 240.05 | |
| 97% |
| 16732-65-3 | |
| MFCD02664469 | |
| SVBVYRYROZWKNJ-UHFFFAOYSA-N | |
| 6-bromo-1H-indole-2-carboxylic acid | |
| 4011696 | |
| Solid | |
| 6-Bromoindole-2-carboxylic acid |
Safety and Handling
GHS H Statement
H315-H319-H335
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
P261-P280-P305+P351+P338-P304+P340-P405-P501a
Avoid breathing dust/fume/gas/mist/vapors/spray.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses, if present and easy to do.
Continue rinsing.
IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing.
Store locked up.
Dispose of contents/container in accordance with local/regional/national/international regulations.
Warning
storageNote1 : 2° to 8°C