missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
5-Nitroacenaphthene (contains 3-Nitroacenaphthene) 80.0+%, TCI America™
Supplier: TCI America N010525G
Specifications
| 5-Nitroacenaphthene (contains 3-Nitroacenaphthene) | |
| 102°C | |
| C12H9NO2 | |
| 25 g | |
| 5-nitroacenaphthene, 5-nitroacenapthene, acenaphthene, 5-nitro, acenaphthylene, 1,2-dihydro-5-nitro, 5-nan, 1,2-dihydro-5-nitro-acenaphthylene, 5-nitronaphthalene ethylene, 5-nitronaphthalene, 1,2-dihydro-5-nitroacenaphthylene, ccris 438 | |
| [O-][N+](=O)C1=C2C=CC=C3CCC(C=C1)=C23 | |
| 199.21 | |
| CHEBI:82350 | |
| ≥80.0% (GC) |
| 602-87-9 | |
| Yellow | |
| MFCD00014277 | |
| 2811 | |
| CUARLQDWYSRQDF-UHFFFAOYSA-N | |
| 5-nitro-1,2-dihydroacenaphthylene | |
| 11769 | |
| 199.21 | |
| Crystalline Powder |
Chemical Identifiers
| 602-87-9 | |
| 199.21 | |
| CUARLQDWYSRQDF-UHFFFAOYSA-N | |
| 11769 | |
| 5-nitro-1,2-dihydroacenaphthylene |
| C12H9NO2 | |
| MFCD00014277 | |
| 5-nitroacenaphthene, 5-nitroacenapthene, acenaphthene, 5-nitro, acenaphthylene, 1,2-dihydro-5-nitro, 5-nan, 1,2-dihydro-5-nitro-acenaphthylene, 5-nitronaphthalene ethylene, 5-nitronaphthalene, 1,2-dihydro-5-nitroacenaphthylene, ccris 438 | |
| CHEBI:82350 | |
| [O-][N+](=O)C1=C2C=CC=C3CCC(C=C1)=C23 |
Safety and Handling
EINECSNumber : (4)-0352
RTECSNumber : AB1060000
TSCA : Yes