missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
(+)-5-Iodo-2'-deoxyuridine, 99%, ACROS Organics™
Manufacturer: Thermo Fisher Scientific 122350010
Specifications
| (+)-5-Iodo-2′-deoxyuridine | |
| 1% max. (1 g, 60°C) (vacuum) | |
| + 280.00 (20.00°C c=1,1M NaOH) | |
| Beige to White | |
| 1g | |
| 98.5 | |
| 0.99 | |
| MFCD00134656 | |
| 5-iodo-2'-deoxyuridine, 5-iododeoxyuridine, allergan 211, idoxene, idoxuridin, idoxuridine, iododeoxyridine, iodoxuridine, iudr, joddeoxiuridin | |
| XQFRJNBWHJMXHO-UHFFFAOYNA-N | |
| 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-iodopyrimidine-2,4-dione | |
| 5905 | |
| 354.09 | |
| 99% |
| Authentic | |
| Glass bottle | |
| + 280.00 | |
| 155.0°C to 180.0°C | |
| 54-42-2 | |
| 100 | |
| C9H11IN2O5 | |
| 15, 4931 | |
| Solubility in water: 1.6g/L (20°C). Other solubilities: 2.0g/L hcl 0.2n- 74.0g/L naoh 0.2n (25°C),4.4g/L methanol- 2.6g/L alcohol (25°C),0.014g/L ether- 0.003g/L chloroform (25°C),1.6g/L acetone- 1.8g/L ethyl acetate (25°C),5.7 | |
| OCC1OC(CC1O)N1C=C(I)C(=O)NC1=O | |
| 354.10 | |
| CHEBI:147675 | |
| Crystalline Powder |
Chemical Identifiers
| 54-42-2 | |
| 354.10 | |
| XQFRJNBWHJMXHO-UHFFFAOYNA-N | |
| 5905 | |
| 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-iodopyrimidine-2,4-dione |
| C9H11IN2O5 | |
| MFCD00134656 | |
| 5-iodo-2'-deoxyuridine, 5-iododeoxyuridine, allergan 211, idoxene, idoxuridin, idoxuridine, iododeoxyridine, iodoxuridine, iudr, joddeoxiuridin | |
| CHEBI:147675 | |
| OCC1OC(CC1O)N1C=C(I)C(=O)NC1=O |
Safety and Handling
Causes serious eye irritation, Suspected of causing genetic defects, Suspected of damaging the unborn child, May cause respiratory irritation, Causes skin irritation
Serious eye damage/eye irritation (category 2), Germ cell mutagenicity (category 2), Reproductive toxicity (category 2), Specific target organ toxicity after single exposure (category 3), Skin corrosion/irritation (category 2)
EINECSNumber : 200-207-8
RUO – Research Use Only