Learn More
(+)-5-Iodo-2'-deoxyuridine, 99%, ACROS Organics™
Manufacturer: Acros Organics 122350010
Specifications
| (+)-5-Iodo-2′-deoxyuridine | |
| 1% max. (1 g, 60°C) (vacuum) | |
| + 280.00 (20.00°C c=1,1M NaOH) | |
| Beige to White | |
| 1g | |
| 98.5 | |
| 99% | |
| MFCD00134656 | |
| idoxuridine, 5-iodo-2'-deoxyuridine, idoxuridin, 5-iododeoxyuridine, iododeoxyridine, iodoxuridine, iudr, joddeoxiuridin, idoxene, allergan 211 | |
| C1C(C(OC1N2C=C(C(=O)NC2=O)I)CO)O | |
| 354.1 | |
| CHEBI:147675 | |
| Crystalline Powder |
| Authentic | |
| Glass bottle | |
| + 280.00 | |
| 155.0°C to 180.0°C | |
| 54-42-2 | |
| 100.0 | |
| C9H11IN2O5 | |
| 15, 4931 | |
| XQFRJNBWHJMXHO-RRKCRQDMSA-N | |
| 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-iodopyrimidine-2,4-dione | |
| 5905 | |
| 354.09 | |
| 99% |
Chemical Identifiers
| 54-42-2 | |
| 354.1 | |
| XQFRJNBWHJMXHO-RRKCRQDMSA-N | |
| 5905 | |
| 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-iodopyrimidine-2,4-dione |
| C9H11IN2O5 | |
| MFCD00134656 | |
| idoxuridine, 5-iodo-2'-deoxyuridine, idoxuridin, 5-iododeoxyuridine, iododeoxyridine, iodoxuridine, iudr, joddeoxiuridin, idoxene, allergan 211 | |
| CHEBI:147675 | |
| C1C(C(OC1N2C=C(C(=O)NC2=O)I)CO)O |
Safety and Handling
GHS H Statement:
Causes skin irritation.
Suspected of causing genetic defects.
Causes serious eye irritation.
May cause respiratory irritation.
Suspected of damaging the unborn child.
GHS P Statement:
Use personal protective equipment as required.
Avoid breathing dust/fume/gas/mist/vapors/spray.
IF ON SKIN: Wash with plenty of soap and water.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.
WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification.
Warning