missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
5-Hydroxy-p-naphthoquinone, 97%, ACROS Organics™
Manufacturer: Thermo Fisher Scientific 121640050
Specifications
| 5-Hydroxy-p-naphthoquinone | |
| Glass bottle | |
| 161.0°C to 163.0°C | |
| 97% | |
| 96.0 | |
| 96% min. (HPLC) | |
| MFCD00001684 | |
| 15, 5317 | |
| Solubility in water: soluble in hot water. Other solubilities: soluble in aq.sol. of alkalies,soluble in alcohol and ether | |
| C1=CC2=C(C(=O)C=CC2=O)C(=C1)O | |
| 174.16 | |
| CHEBI:15794 | |
| Crystalline Powder |
| Authentic | |
| Brown to Orange | |
| 5g | |
| 481-39-0 | |
| 100.0 | |
| C10H6O3 | |
| 08, 308 | |
| 5-hydroxy-1,4-naphthalenedione, 5-hydroxy-1,4-naphthoquinone, 5-hydroxynaphthoquinone, akhnot, juglon, juglone, nucin, regianin, walnut extract, yuglon | |
| KQPYUDDGWXQXHS-UHFFFAOYSA-N | |
| 5-hydroxynaphthalene-1,4-dione | |
| 3806 | |
| 174.16 | |
| 97% |
Chemical Identifiers
| 481-39-0 | |
| 174.16 | |
| KQPYUDDGWXQXHS-UHFFFAOYSA-N | |
| 3806 | |
| 5-hydroxynaphthalene-1,4-dione |
| C10H6O3 | |
| MFCD00001684 | |
| 5-hydroxy-1,4-naphthalenedione, 5-hydroxy-1,4-naphthoquinone, 5-hydroxynaphthoquinone, akhnot, juglon, juglone, nucin, regianin, walnut extract, yuglon | |
| CHEBI:15794 | |
| C1=CC2=C(C(=O)C=CC2=O)C(=C1)O |
Safety and Handling
GHS H Statement
Causes serious eye irritation.
Toxic if swallowed.
May cause respiratory irritation.
Causes skin irritation.
Very toxic to aquatic life.
GHS P Statement
IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician.
Avoid breathing dust/fume/gas/mist/vapors/spray.
IF ON SKIN: Wash with plenty of soap and water.
Wear protective gloves/protective clothing/eye prot
GHS Signal Word: Danger
EINECSNumber : 207-567-5
RTECSNumber : QJ5775000