Learn More
5-chloro-3-phenyl-2,1-benzisoxazole, 97%, ACROS Organics™
Manufacturer: Thermo Fisher Scientific AC438380050
Specifications
| 5-Chloro-3-phenyl-2, 1-benzisoxazole | |
| Glass Bottle | |
| 115.3°C to 116.1°C | |
| 719-64-2 | |
| 100.0 | |
| C13H8ClNO | |
| MUHJZJKVEQASGY-UHFFFAOYSA-N | |
| 5-chloro-3-phenyl-2,1-benzoxazole | |
| 347291 | |
| Crystalline Powder |
| Authentic | |
| Yellow | |
| 5g | |
| 96.0 | |
| 96% min. (GC) | |
| 2, 5-chloro-3-phenyl, 3-phenyl-5-chloro-2,1-benzisoxazole, 3-phenyl-5-chloroanthranil, 5-chloro-3-phenyl-2,1-benzisoxazole, 5-chloro-3-phenyl-benzo c isoxazole, 5-chloro-3-phenylanthranil, 5-chloro-3-phenylbenzo c isoxazole, acmc-209okx, maybridge1_004397, pubchem8713 | |
| C1=CC=C(C=C1)C2=C3C=C(C=CC3=NO2)Cl | |
| 229.67 | |
| 229.67 | |
| 97% |
Chemical Identifiers
| 719-64-2 | |
| 229.67 | |
| 2, 5-chloro-3-phenyl, 3-phenyl-5-chloro-2,1-benzisoxazole, 3-phenyl-5-chloroanthranil, 5-chloro-3-phenyl-2,1-benzisoxazole, 5-chloro-3-phenyl-benzo c isoxazole, 5-chloro-3-phenylanthranil, 5-chloro-3-phenylbenzo c isoxazole, acmc-209okx, maybridge1_004397, pubchem8713 | |
| 5-chloro-3-phenyl-2,1-benzoxazole |
| C13H8ClNO | |
| MUHJZJKVEQASGY-UHFFFAOYSA-N | |
| 347291 | |
| C1=CC=C(C=C1)C2=C3C=C(C=CC3=NO2)Cl |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement GHS Signal Word: Warning EINECSNumber : 211-950-2
Wear protective gloves/eye protection/face protection.
IF ON SKIN: Wash with plenty of soap and water.
IF INHALED: If breathing is difficult,remove to fresh air and keep at rest in a position comfortable for breathing.