Learn More
5,7-Dichloro-8-hydroxyquinoline 99%, ACROS Organics™
Manufacturer: Thermo Fisher Scientific 113431000
Specifications
| 5, 7-Dichloro-8-hydroxyquinoline | |
| Glass bottle | |
| 178°C to 183°C | |
| 99% | |
| 98.5 | |
| 98% | |
| MFCD00006786 | |
| 15, 2181 | |
| Solubility in water: practically insoluble. Other solubilities: soluble in water at ph 1 or >9;,slightly soluble in ethanol,acetone,chloroform,,and dmso;,soluble in alkali,benzene,petroleum ether | |
| C1=CC2=C(C(=C(C=C2Cl)Cl)O)N=C1 | |
| 214.05 | |
| CHEBI:59477 | |
| Fluffy Powder |
| Authentic | |
| Beige | |
| 100g | |
| 773-76-2 | |
| 100.0 | |
| C9H5Cl2NO | |
| 21, 95 | |
| 5,7-dichloro-8-hydroxyquinoline | |
| WDFKMLRRRCGAKS-UHFFFAOYSA-N | |
| 5,7-dichloroquinolin-8-ol | |
| 2722 | |
| 214.05 | |
| 0.98 |
Chemical Identifiers
| 773-76-2 | |
| 214.05 | |
| WDFKMLRRRCGAKS-UHFFFAOYSA-N | |
| 2722 | |
| 5,7-dichloroquinolin-8-ol |
| C9H5Cl2NO | |
| MFCD00006786 | |
| 5,7-dichloro-8-hydroxyquinoline | |
| CHEBI:59477 | |
| C1=CC2=C(C(=C(C=C2Cl)Cl)O)N=C1 |
Safety and Handling
GHS H StatementMay cause respiratory irritation.Causes skin irritation.Causes serious eye irritation.
GHS P StatementIF ON SKIN: Wash with plenty of soap and water.If eye irritation persists: Get medical advice/attention.IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing.Call a POISON CENTER or doctor/physician if you feel unwell.
;GHS P StatementIF ON SKIN: Wash with plenty of soap and water.If eye irritation persists: Get medical advice/attention.IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing.Call a POISON CENTER or doctor/
EINECSNumber : 212-258-3
RTECSNumber : VC5350000
TSCA : TSCA