missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
5,5'-Dithiobis-(2-nitrobenzoic acid), 99%, ACROS Organics™
Manufacturer: Thermo Fisher Scientific AC117540010
Specifications
| 5, 5'-Dithiobis-(2-nitrobenzoic acid) | |
| 240.0°C to 245.0°C | |
| 69-78-3 | |
| C14H8N2O8S2 | |
| MFCD00007140 | |
| 01,351 | |
| 3,3'-dithiobis 6-nitrobenzoic acid, 3-carboxy-4-nitrophenyl disulfide, 5,5'-disulfanediylbis 2-nitrobenzoic acid, 5,5'-dithio-bis 2-nitrobenzoic acid, 5,5'-dithiobis 2-nitrobenzoic acid, benzoic acid, 3,3'-dithiobis 6-nitro, dithiobisnitrobenzoic acid, dithionitrobenzoic acid, dtnb, ellman's reagent | |
| KIUMMUBSPKGMOY-UHFFFAOYSA-N | |
| 5-[(3-carboxy-4-nitrophenyl)disulfanyl]-2-nitrobenzoic acid | |
| 6254 | |
| 396.34 |
| Glass bottle | |
| 1g | |
| 99% | |
| [-SC6H3(NO2)CO2H]2 | |
| 10, IV, 344 | |
| 15, 3606 | |
| Solubility in water: freely soluble | |
| OC(=O)C1=CC(SSC2=CC=C(C(=C2)C(O)=O)[N+]([O-])=O)=CC=C1[N+]([O-])=O | |
| 396.34 | |
| CHEBI:86228 | |
| 99% |
Chemical Identifiers
| 69-78-3 | |
| 396.34 | |
| KIUMMUBSPKGMOY-UHFFFAOYSA-N | |
| 6254 | |
| 5-[(3-carboxy-4-nitrophenyl)disulfanyl]-2-nitrobenzoic acid |
| C14H8N2O8S2 | |
| MFCD00007140 | |
| 3,3'-dithiobis 6-nitrobenzoic acid, 3-carboxy-4-nitrophenyl disulfide, 5,5'-disulfanediylbis 2-nitrobenzoic acid, 5,5'-dithio-bis 2-nitrobenzoic acid, 5,5'-dithiobis 2-nitrobenzoic acid, benzoic acid, 3,3'-dithiobis 6-nitro, dithiobisnitrobenzoic acid, dithionitrobenzoic acid, dtnb, ellman's reagent | |
| CHEBI:86228 | |
| OC(=O)C1=CC(SSC2=CC=C(C(=C2)C(O)=O)[N+]([O-])=O)=CC=C1[N+]([O-])=O |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if present and easy to do.
Continue rinsing.
GHS Signal Word: Warning
EINECSNumber : 200-714-4