Learn More
5,5-Diphenylhydantoin sodium salt, 99%, ACROS Organics™
Manufacturer: Acros Organics AC436101000
Specifications
| 5, 5-Diphenylhydantoin sodium salt | |
| 98.5 | |
| 99% | |
| Phenytoin sodium, Sodium 5, 5-diphenyl-2, 4-imidazolidinedione | |
| [HH].C1=CC=C(C=C1)C2(C(=O)NC(=O)N2)C3=CC=CC=C3.[Na] | |
| 277.279 | |
| 274.25 | |
| 98.5 to 100.5% (anhydrous substance) | |
| Glass bottle | |
| White |
| 630-93-3 | |
| 100.0 | |
| C15H14N2NaO2 | |
| KKDHPEZTVGUWOE-UHFFFAOYSA-N | |
| 5,5-diphenylimidazolidine-2,4-dione;molecular hydrogen;sodium | |
| 131674077 | |
| Crystalline Powder | |
| Authentic | |
| 3% Max. | |
| 100g |
Chemical Identifiers
| 630-93-3 | |
| 277.279 | |
| Phenytoin sodium, Sodium 5, 5-diphenyl-2, 4-imidazolidinedione | |
| 5,5-diphenylimidazolidine-2,4-dione;molecular hydrogen;sodium |
| C15H14N2NaO2 | |
| KKDHPEZTVGUWOE-UHFFFAOYSA-N | |
| 131674077 | |
| [HH].C1=CC=C(C=C1)C2(C(=O)NC(=O)N2)C3=CC=CC=C3.[Na] |
Safety and Handling
GHS H Statement:
Harmful if swallowed.
May cause an allergic skin reaction.
Suspected of causing cancer.
Suspected of damaging fertility. Suspected of damaging the unborn child.
GHS P Statement:
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
Wear protective gloves/protective clothing/eye protection/face protection.
Obtain special instructions before use.
IF exposed or concerned: Get medical attention/advice.
WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification.