missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
4'-(Trifluoromethyl)biphenyl-2-carboxylic Acid 98.0+%, TCI America™
Supplier: TCI America T32311G
Specifications
| 4′-(Trifluoromethyl)biphenyl-2-carboxylic Acid | |
| 171°C | |
| C14H9F3O2 | |
| 1 g | |
| IQOMYCGTGFGDFN-UHFFFAOYSA-N | |
| 4'-(trifluoromethyl)-[1,1'-biphenyl]-2-carboxylic acid | |
| 55251 | |
| ≥98.0% (GC,T) |
| 84392-17-6 | |
| White | |
| MFCD00075353 | |
| xenalipin, 4-trifluoromethyl-2'-biphenylcarboxylic acid, xenalipine, 4'-trifluoromethyl-1,1'-biphenyl-2-carboxylic acid, 2-4-trifluoromethyl phenyl benzoic acid, 4'-trifluoromethyl biphenyl-2-carboxylic acid, 4'-trifluoromethyl-2-biphenylcarboxylic acid, 2-4-trifluoromethylphenyl benzoic acid, 4'-trifluoromethyl 1,1'-biphenyl-2-carboxylic acid, 1,1'-biphenyl-2-carboxylic acid, 4'-trifluoromethyl | |
| OC(=O)C1=CC=CC=C1C1=CC=C(C=C1)C(F)(F)F | |
| 266.22 | |
| 266.22 | |
| Crystalline Powder |
Chemical Identifiers
| 84392-17-6 | |
| 266.22 | |
| IQOMYCGTGFGDFN-UHFFFAOYSA-N | |
| 55251 | |
| OC(=O)C1=CC=CC=C1C1=CC=C(C=C1)C(F)(F)F |
| C14H9F3O2 | |
| MFCD00075353 | |
| xenalipin, 4-trifluoromethyl-2'-biphenylcarboxylic acid, xenalipine, 4'-trifluoromethyl-1,1'-biphenyl-2-carboxylic acid, 2-4-trifluoromethyl phenyl benzoic acid, 4'-trifluoromethyl biphenyl-2-carboxylic acid, 4'-trifluoromethyl-2-biphenylcarboxylic acid, 2-4-trifluoromethylphenyl benzoic acid, 4'-trifluoromethyl 1,1'-biphenyl-2-carboxylic acid, 1,1'-biphenyl-2-carboxylic acid, 4'-trifluoromethyl | |
| 4'-(trifluoromethyl)-[1,1'-biphenyl]-2-carboxylic acid |
Safety and Handling
TSCA : No