missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
4-Nitrophenyl sulfate, potassium salt, 99+%, ACROS Organics™
Manufacturer: Thermo Fisher Scientific 227490010
Specifications
| 4-Nitrophenyl sulfate, potassium salt | |
| Glass bottle | |
| 246.0°C to 250.0°C | |
| 6217-68-1 | |
| 100.0 | |
| C6H4KNO6S | |
| MFCD00149530 | |
| 4-nitrophenyl sulfate potassium salt, p-nitrophenyl sulfate potassium salt, phenol, p-nitro-, hydrogen sulfate ester , potassium salt, potassium 4-nitrophenyl sulfate, potassium 4-nitrophenyl sulphate, potassium p-nitrophenyl sulfate, potassium p-nitrophenyl sulphate, sulfuric acid, mono 4-nitrophenyl ester, potassium salt, sulfuric acid, mono 4-nitrophenyl ester, potassium salt 1:1 | |
| BITVAZYUWRLLCN-UHFFFAOYSA-M | |
| potassium;(4-nitrophenyl) sulfate | |
| 80348 | |
| Crystalline Powder |
| Authentic | |
| Yellow | |
| 1g | |
| 99.0 | |
| 0.05% max. free p-nitrophenol (HPLC) | |
| O2NC6H4OSO3K | |
| 06, II, 225 | |
| Solubility in water: slightly soluble in water. | |
| C1=CC(=CC=C1[N+](=O)[O-])OS(=O)(=O)[O-].[K+] | |
| 257.26 | |
| 257.26 | |
| 99+% |
Chemical Identifiers
| 6217-68-1 | |
| 257.26 | |
| BITVAZYUWRLLCN-UHFFFAOYSA-M | |
| 80348 | |
| C1=CC(=CC=C1[N+](=O)[O-])OS(=O)(=O)[O-].[K+] |
| C6H4KNO6S | |
| MFCD00149530 | |
| 4-nitrophenyl sulfate potassium salt, p-nitrophenyl sulfate potassium salt, phenol, p-nitro-, hydrogen sulfate ester , potassium salt, potassium 4-nitrophenyl sulfate, potassium 4-nitrophenyl sulphate, potassium p-nitrophenyl sulfate, potassium p-nitrophenyl sulphate, sulfuric acid, mono 4-nitrophenyl ester, potassium salt, sulfuric acid, mono 4-nitrophenyl ester, potassium salt 1:1 | |
| potassium;(4-nitrophenyl) sulfate |
Safety and Handling
EINECSNumber : 228-288-5