missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
4'-Methyl-4-pentylbiphenyl 98.0+%, TCI America™
Supplier: TCI America M28851G
Specifications
| 4′-Methyl-4-pentylbiphenyl | |
| 49°C | |
| C18H22 | |
| 1 g | |
| ZGBOHJUSTPZQPL-UHFFFAOYSA-N | |
| 4-methyl-4'-pentyl-1,1'-biphenyl | |
| 103038 | |
| ≥98.0% (GC) |
| 64835-63-8 | |
| White | |
| MFCD11053476 | |
| 4-Amyl-4′-methylbiphenyl | |
| CCCCCC1=CC=C(C=C1)C1=CC=C(C)C=C1 | |
| 238.37 | |
| 238.37 | |
| Crystalline Powder |
Chemical Identifiers
| 64835-63-8 | |
| 238.37 | |
| ZGBOHJUSTPZQPL-UHFFFAOYSA-N | |
| 103038 | |
| CCCCCC1=CC=C(C=C1)C1=CC=C(C)C=C1 |
| C18H22 | |
| MFCD11053476 | |
| 4-Amyl-4′-methylbiphenyl | |
| 4-methyl-4'-pentyl-1,1'-biphenyl |
Safety and Handling
TSCA : Yes