missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
4-Methyl-2-phenyl-1,3-oxazole-5-carbaldehyde, 95%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals CC18104CB
Specifications
| 4-Methyl-2-phenyl-1, 3-oxazole-5-carbaldehyde | |
| 94.5 | |
| 95% | |
| C11H9NO2 | |
| 250mg | |
| NIYJTYPVRBYCEZ-UHFFFAOYSA-N | |
| 4-methyl-2-phenyl-1,3-oxazole-5-carbaldehyde | |
| 26343583 | |
| 95% |
| 953408-85-0 | |
| 100.0 | |
| Amber Glass Bottle | |
| MFCD11109318 | |
| 5-formyl-4-methyl-2-phenyl-1,3-oxazole, 4-methyl-2-phenyloxazole-5-carbaldehyde, 4-methyl-2-phenyl-1,3-oxazole-5-carboxaldehyde | |
| CC1=C(OC(=N1)C2=CC=CC=C2)C=O | |
| 187.198 | |
| 187.2 |
Chemical Identifiers
| 953408-85-0 | |
| 187.198 | |
| NIYJTYPVRBYCEZ-UHFFFAOYSA-N | |
| 26343583 | |
| CC1=C(OC(=N1)C2=CC=CC=C2)C=O |
| C11H9NO2 | |
| MFCD11109318 | |
| 5-formyl-4-methyl-2-phenyl-1,3-oxazole, 4-methyl-2-phenyloxazole-5-carbaldehyde, 4-methyl-2-phenyl-1,3-oxazole-5-carboxaldehyde | |
| 4-methyl-2-phenyl-1,3-oxazole-5-carbaldehyde |