missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
4-Hydroxy-3-nitroso-1-naphthalenesulfonic Acid Hydrate 98.0+%, TCI America™
Supplier: TCI America N02695G
Specifications
| 4-Hydroxy-3-nitroso-1-naphthalenesulfonic Acid Hydrate | |
| 145°C | |
| MFCD00003933 | |
| 2-nitroso-1-naphthol-4-sulfonic acid, 4-hydroxy-3-nitroso-1-naphthalenesulfonic acid, 1-naphthalenesulfonic acid, 4-hydroxy-3-nitroso, unii-7t06pca43o, 4-hydroxy-3-nitroso-naphthalene-1-sulfonic acid, 4-hydroxy-3-nitrosonaphthalenesulfonic acid, nitroso-nw acid, acmc-1cril, 4-hydroxy-3-nitrosonaphthalene-1-sulphonic acid, 1-naphthalenesulfonicacid, 4-hydroxy-3-nitroso | |
| C1=CC=C2C(=C1)C(=CC(=C2O)N=O)S(=O)(=O)O | |
| 253.228 | |
| 253.23 | |
| Crystalline Powder |
| 3682-32-4 | |
| C10H7NO5S | |
| 5 g | |
| GASPSNIEUBWWJU-UHFFFAOYSA-N | |
| 4-hydroxy-3-nitrosonaphthalene-1-sulfonic acid | |
| 77257 | |
| ≥98.0% (T) |
Chemical Identifiers
| 3682-32-4 | |
| 253.228 | |
| GASPSNIEUBWWJU-UHFFFAOYSA-N | |
| 77257 | |
| C1=CC=C2C(=C1)C(=CC(=C2O)N=O)S(=O)(=O)O |
| C10H7NO5S | |
| MFCD00003933 | |
| 2-nitroso-1-naphthol-4-sulfonic acid, 4-hydroxy-3-nitroso-1-naphthalenesulfonic acid, 1-naphthalenesulfonic acid, 4-hydroxy-3-nitroso, unii-7t06pca43o, 4-hydroxy-3-nitroso-naphthalene-1-sulfonic acid, 4-hydroxy-3-nitrosonaphthalenesulfonic acid, nitroso-nw acid, acmc-1cril, 4-hydroxy-3-nitrosonaphthalene-1-sulphonic acid, 1-naphthalenesulfonicacid, 4-hydroxy-3-nitroso | |
| 4-hydroxy-3-nitrosonaphthalene-1-sulfonic acid |
Safety and Handling
TSCA : Yes