missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
4-Fluorobenzenesulfonyl chloride, 98%, ACROS Organics™
Manufacturer: Thermo Fisher Scientific 119350250
Specifications
| 4-Fluorobenzenesulfonyl chloride | |
| Authentic | |
| 95°C to 96°C (2.0mmHg) | |
| 29°C to 34°C | |
| 349-88-2 | |
| 100.0 | |
| C6H4ClFO2S | |
| MFCD00007438 | |
| 4-fluoro-benzenesulfonyl chloride | |
| C1=CC(=CC=C1F)S(=O)(=O)Cl | |
| 194.61 | |
| 194.61 | |
| 98% |
| >110°C | |
| Glass bottle | |
| Brown to White | |
| 25g | |
| 97.5 | |
| 97.5% min. (ex Cl) (Argentometry) | |
| FC6H4SO2Cl | |
| 11, 53 | |
| BFXHJFKKRGVUMU-UHFFFAOYSA-N | |
| 4-fluorobenzenesulfonyl chloride | |
| 9588 | |
| Crystalline Low Melting Mass |
Chemical Identifiers
| 349-88-2 | |
| 194.61 | |
| BFXHJFKKRGVUMU-UHFFFAOYSA-N | |
| 9588 | |
| C1=CC(=CC=C1F)S(=O)(=O)Cl |
| C6H4ClFO2S | |
| MFCD00007438 | |
| 4-fluoro-benzenesulfonyl chloride | |
| 4-fluorobenzenesulfonyl chloride |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
GHS P Statement
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if pre
GHS Signal Word: Danger
EINECSNumber : 206-493-