missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
4-Fluorobenzenesulfonyl chloride, 98%, ACROS Organics™
$68.63 - $223.42
Chemical Identifiers
| CAS | 349-88-2 |
|---|---|
| Molecular Formula | C6H4ClFO2S |
| Molecular Weight (g/mol) | 194.61 |
| MDL Number | MFCD00007438 |
| InChI Key | BFXHJFKKRGVUMU-UHFFFAOYSA-N |
| Synonym | 4-fluoro-benzenesulfonyl chloride, 4-fluorobenzene-1-sulfonyl chloride, 4-fluorobenzenesulfonic acid chloride, 4-fluorobenzenesulfonylchloride, 4-fluorobenzenesulphonyl chloride, 4-fluorobenzensulfonyl chloride, 4-fluorophenylsulfonyl chloride, benzenesulfonyl chloride, 4-fluoro, benzenesulfonyl chloride, p-fluoro, p-fluorobenzenesulfonyl chloride |
| PubChem CID | 9588 |
| IUPAC Name | 4-fluorobenzenesulfonyl chloride |
| SMILES | C1=CC(=CC=C1F)S(=O)(=O)Cl |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
| AC119350250 SDS |
Thermo Fisher Scientific
119350250 |
25g | Glass bottle |
Each for $68.63
|
|
AC119351000 SDS |
Thermo Fisher Scientific
119351000 |
100g | Glass bottle |
Each for $223.42
|
|
AC119355000 SDS |
Thermo Fisher Scientific
AC119355000 |
500g | Glass bottle | N/A | N/A |
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
Chemical Identifiers
| 349-88-2 | |
| 194.61 | |
| BFXHJFKKRGVUMU-UHFFFAOYSA-N | |
| 9588 | |
| C1=CC(=CC=C1F)S(=O)(=O)Cl |
| C6H4ClFO2S | |
| MFCD00007438 | |
| 4-fluoro-benzenesulfonyl chloride, 4-fluorobenzene-1-sulfonyl chloride, 4-fluorobenzenesulfonic acid chloride, 4-fluorobenzenesulfonylchloride, 4-fluorobenzenesulphonyl chloride, 4-fluorobenzensulfonyl chloride, 4-fluorophenylsulfonyl chloride, benzenesulfonyl chloride, 4-fluoro, benzenesulfonyl chloride, p-fluoro, p-fluorobenzenesulfonyl chloride | |
| 4-fluorobenzenesulfonyl chloride |
Specifications
| >110°C | |
| Glass bottle | |
| Brown to White | |
| 25g | |
| 97.5 | |
| 97.5% min. (ex Cl) (Argentometry) | |
| FC6H4SO2Cl | |
| 11, 53 | |
| BFXHJFKKRGVUMU-UHFFFAOYSA-N | |
| 4-fluorobenzenesulfonyl chloride | |
| 9588 | |
| Crystalline Low Melting Mass | |
| 4-Fluorobenzenesulfonyl chloride |
| Authentic | |
| 95°C to 96°C (2.0mmHg) | |
| 29°C to 34°C | |
| 349-88-2 | |
| 100.0 | |
| C6H4ClFO2S | |
| MFCD00007438 | |
| 4-fluoro-benzenesulfonyl chloride, 4-fluorobenzene-1-sulfonyl chloride, 4-fluorobenzenesulfonic acid chloride, 4-fluorobenzenesulfonylchloride, 4-fluorobenzenesulphonyl chloride, 4-fluorobenzensulfonyl chloride, 4-fluorophenylsulfonyl chloride, benzenesulfonyl chloride, 4-fluoro, benzenesulfonyl chloride, p-fluoro, p-fluorobenzenesulfonyl chloride | |
| C1=CC(=CC=C1F)S(=O)(=O)Cl | |
| 194.61 | |
| 194.61 | |
| 98% |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
GHS P Statement
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if pre
GHS Signal Word: Danger
EINECSNumber : 206-493-