missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
4-Biphenyl isocyanate, 97%, ACROS Organics™
Manufacturer: Thermo Fisher Scientific AC438500050
Specifications
| 4-Biphenyl isocyanate | |
| 110.0°C to 112.0°C (1.0 mmHg) | |
| 60.0°C to 61.0°C | |
| 92-95-5 | |
| 100.0 | |
| C13H9NO | |
| 4-biphenyl isocyanate, 4-biphenylyl isocyanate, 4-biphenylylisocyanate, 4-isocyanatobiphenyl, 4-phenylphenyl isocyanate, b0zsp4upq4, p-diphenyl isocyanate, p-xenylcarbimide, p-xenylcarbimide mi, unii-b0zsp4upq4 | |
| C1=CC=C(C=C1)C2=CC=C(C=C2)N=C=O | |
| 195.22 | |
| 195.22 | |
| 97% |
| Authentic | |
| Brown to Orange | |
| 5g | |
| 96.0 | |
| 96% min. (GC) | |
| 15,10271 | |
| WIRPZDICFIIBRF-UHFFFAOYSA-N | |
| 1-isocyanato-4-phenylbenzene | |
| 3612319 | |
| Solution |
Chemical Identifiers
| 92-95-5 | |
| 195.22 | |
| 4-biphenyl isocyanate, 4-biphenylyl isocyanate, 4-biphenylylisocyanate, 4-isocyanatobiphenyl, 4-phenylphenyl isocyanate, b0zsp4upq4, p-diphenyl isocyanate, p-xenylcarbimide, p-xenylcarbimide mi, unii-b0zsp4upq4 | |
| 1-isocyanato-4-phenylbenzene |
| C13H9NO | |
| WIRPZDICFIIBRF-UHFFFAOYSA-N | |
| 3612319 | |
| C1=CC=C(C=C1)C2=CC=C(C=C2)N=C=O |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Harmful in contact with skin.
Causes skin irritation.
May cause an allergic skin reaction.
Causes serious eye irritation.
Harmful if inhaled.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
Call a POISON CENTER or doctor/physician if you feel unwell.
IF ON SKIN: Wash with plen
GHS Signal Word: Danger