Learn More
4-Benzyloxyaniline hydrochloride, 98%, Thermo Scientific™
$128.21 - $128.21
Chemical Identifiers
| CAS | 51388-20-6 |
|---|---|
| Molecular Formula | C13H13NO·HCl |
| Molecular Weight (g/mol) | 235.72 |
| MDL Number | MFCD00012995 |
| InChI Key | KQBDLOVXZHOAJI-UHFFFAOYSA-N |
| Synonym | 4-benzyloxy aniline hydrochloride, 4-benzyloxy phenyl amine hydrochloride, 4-benzyloxyaniline hcl, 4-benzyloxyaniline hydrochloride, 4-phenylmethoxy phenylamine, chloride, 4-phenylmethoxyaniline hydrochloride, acmc-20amop, aniline, p-benzyloxy-hydrochloride, benzenamine, 4-phenylmethoxy-, hydrochloride, pubchem21343 |
| PubChem CID | 2723831 |
| IUPAC Name | 4-phenylmethoxyaniline;hydrochloride |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)N.Cl |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC152291000
|
Thermo Fisher Scientific
152291000 |
100g | Plastic bottle |
Each for $128.21
|
|
||||
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 51388-20-6 | |
| 235.72 | |
| KQBDLOVXZHOAJI-UHFFFAOYSA-N | |
| 2723831 | |
| C1=CC=C(C=C1)COC2=CC=C(C=C2)N.Cl |
| C13H13NO·HCl | |
| MFCD00012995 | |
| 4-benzyloxy aniline hydrochloride, 4-benzyloxy phenyl amine hydrochloride, 4-benzyloxyaniline hcl, 4-benzyloxyaniline hydrochloride, 4-phenylmethoxy phenylamine, chloride, 4-phenylmethoxyaniline hydrochloride, acmc-20amop, aniline, p-benzyloxy-hydrochloride, benzenamine, 4-phenylmethoxy-, hydrochloride, pubchem21343 | |
| 4-phenylmethoxyaniline;hydrochloride |
Specifications
| 51388-20-6 | |
| 100.0 | |
| 228°C | |
| C13H13NO·HCl | |
| C6H5CH2OC6H4NH2·HCl | |
| Plastic bottle | |
| 100g | |
| Solubility in water: slightly soluble | |
| C1=CC=C(C=C1)COC2=CC=C(C=C2)N.Cl | |
| 235.72 | |
| 235.72 | |
| 98% |
| 97.5 | |
| Brown | |
| 98% | |
| Authentic | |
| MFCD00012995 | |
| 13, 439 | |
| 4-benzyloxy aniline hydrochloride, 4-benzyloxy phenyl amine hydrochloride, 4-benzyloxyaniline hcl, 4-benzyloxyaniline hydrochloride, 4-phenylmethoxy phenylamine, chloride, 4-phenylmethoxyaniline hydrochloride, acmc-20amop, aniline, p-benzyloxy-hydrochloride, benzenamine, 4-phenylmethoxy-, hydrochloride, pubchem21343 | |
| KQBDLOVXZHOAJI-UHFFFAOYSA-N | |
| 4-phenylmethoxyaniline;hydrochloride | |
| 2723831 | |
| Crystalline Powder | |
| 4-Benzyloxyaniline hydrochloride, 98% |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
Avoid breathing dust/fume/gas/mist/vapors/spray.
IF ON SKIN: Wash with plenty of soap and water.
IF IN EYES: Rinse cautiously with water for
GHS Signal Word: Warning
EINECSNumber : 257-170-6
RUO – Research Use Only