missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
4-Benzyloxyaniline hydrochloride, 98%, ACROS Organics™
$129.00 - $129.00
Chemical Identifiers
| CAS | 51388-20-6 |
|---|---|
| Molecular Formula | C13H13NO·HCl |
| Molecular Weight (g/mol) | 235.72 |
| MDL Number | MFCD00012995 |
| InChI Key | KQBDLOVXZHOAJI-UHFFFAOYSA-N |
| Synonym | 4-benzyloxy aniline hydrochloride, 4-benzyloxy phenyl amine hydrochloride, 4-benzyloxyaniline hcl, 4-benzyloxyaniline hydrochloride, 4-phenylmethoxy phenylamine, chloride, 4-phenylmethoxyaniline hydrochloride, acmc-20amop, aniline, p-benzyloxy-hydrochloride, benzenamine, 4-phenylmethoxy-, hydrochloride, pubchem21343 |
| PubChem CID | 2723831 |
| IUPAC Name | 4-phenylmethoxyaniline;hydrochloride |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)N.Cl |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC152290250
|
Thermo Fisher Scientific
152290250 |
25g | Plastic bottle |
N/A
|
N/A | ||||
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
|
AC152291000
|
Thermo Fisher Scientific
152291000 |
100g | Plastic bottle |
Each for $129.00
|
|
||||
Chemical Identifiers
| 51388-20-6 | |
| 235.72 | |
| KQBDLOVXZHOAJI-UHFFFAOYSA-N | |
| 2723831 | |
| C1=CC=C(C=C1)COC2=CC=C(C=C2)N.Cl |
| C13H13NO·HCl | |
| MFCD00012995 | |
| 4-benzyloxy aniline hydrochloride, 4-benzyloxy phenyl amine hydrochloride, 4-benzyloxyaniline hcl, 4-benzyloxyaniline hydrochloride, 4-phenylmethoxy phenylamine, chloride, 4-phenylmethoxyaniline hydrochloride, acmc-20amop, aniline, p-benzyloxy-hydrochloride, benzenamine, 4-phenylmethoxy-, hydrochloride, pubchem21343 | |
| 4-phenylmethoxyaniline;hydrochloride |
Specifications
| Authentic | |
| Brown | |
| 25g | |
| 97.5 | |
| 98% | |
| C6H5CH2OC6H4NH2·HCl | |
| 13, 439 | |
| Solubility in water: slightly soluble | |
| C1=CC=C(C=C1)COC2=CC=C(C=C2)N.Cl | |
| 235.72 | |
| 235.72 | |
| 98% |
| Plastic bottle | |
| 228°C | |
| 51388-20-6 | |
| 100.0 | |
| C13H13NO·HCl | |
| MFCD00012995 | |
| 4-benzyloxy aniline hydrochloride, 4-benzyloxy phenyl amine hydrochloride, 4-benzyloxyaniline hcl, 4-benzyloxyaniline hydrochloride, 4-phenylmethoxy phenylamine, chloride, 4-phenylmethoxyaniline hydrochloride, acmc-20amop, aniline, p-benzyloxy-hydrochloride, benzenamine, 4-phenylmethoxy-, hydrochloride, pubchem21343 | |
| KQBDLOVXZHOAJI-UHFFFAOYSA-N | |
| 4-phenylmethoxyaniline;hydrochloride | |
| 2723831 | |
| Crystalline Powder | |
| 4-Benzyloxyaniline hydrochloride, 98% |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
Avoid breathing dust/fume/gas/mist/vapors/spray.
IF ON SKIN: Wash with plenty of soap and water.
IF IN EYES: Rinse cautiously with water for
GHS Signal Word: Warning
EINECSNumber : 257-170-6