missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
4,4'-Bis(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)biphenyl 98.0+%, TCI America™
Supplier: TCI America B31511G
Specifications
| 4,4′-Bis(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)biphenyl | |
| 248°C | |
| C22H28B2O4 | |
| 1 g | |
| NJXUWONHNYJPMY-UHFFFAOYSA-N | |
| 2-[4-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]phenyl]-5,5-dimethyl-1,3,2-dioxaborinane | |
| 16069320 | |
| ≥98.0% (GC,T) |
| 5487-93-4 | |
| White-Yellow | |
| MFCD01318103 | |
| 4,4'-bis 5,5-dimethyl-1,3,2-dioxaborinan-2-yl biphenyl, acmc-209ljv, amtb975, 4,4'-biphenyldiboronic acid bis neopentyl glycol ester, 4,4'-biphenyldiboronic acid bis neopentyl ester, 4,4'-bis 5,5-dimethyl-1,3,2-dioxaborinane-2-yl biphenyl, 4,4-bis 5,5-dimethyl-1,3,2-dioxaborinan-2-yl biphenyl, 4-4'_biphenyldiboronic acid bis neopentyl glycol ester, biphenyl-4,4'-diboronic acid bis neopentyl glycol ester, 4,4-biphenyldiboronic acid bis neopentyl glycol ester | |
| B1(OCC(CO1)(C)C)C2=CC=C(C=C2)C3=CC=C(C=C3)B4OCC(CO4)(C)C | |
| 378.082 | |
| 378.08 | |
| Crystalline Powder |
Chemical Identifiers
| 5487-93-4 | |
| 378.082 | |
| NJXUWONHNYJPMY-UHFFFAOYSA-N | |
| 16069320 | |
| B1(OCC(CO1)(C)C)C2=CC=C(C=C2)C3=CC=C(C=C3)B4OCC(CO4)(C)C |
| C22H28B2O4 | |
| MFCD01318103 | |
| 4,4'-bis 5,5-dimethyl-1,3,2-dioxaborinan-2-yl biphenyl, acmc-209ljv, amtb975, 4,4'-biphenyldiboronic acid bis neopentyl glycol ester, 4,4'-biphenyldiboronic acid bis neopentyl ester, 4,4'-bis 5,5-dimethyl-1,3,2-dioxaborinane-2-yl biphenyl, 4,4-bis 5,5-dimethyl-1,3,2-dioxaborinan-2-yl biphenyl, 4-4'_biphenyldiboronic acid bis neopentyl glycol ester, biphenyl-4,4'-diboronic acid bis neopentyl glycol ester, 4,4-biphenyldiboronic acid bis neopentyl glycol ester | |
| 2-[4-[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]phenyl]-5,5-dimethyl-1,3,2-dioxaborinane |
Safety and Handling
TSCA : No