missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
4-(2-Naphthyl)phenylboronic Acid (contains varying amounts of Anhydride), TCI America™
Supplier: TCI America N09461G
Specifications
| 4-(2-Naphthyl)phenylboronic Acid (contains varying amounts of Anhydride) | |
| White-Yellow | |
| MFCD09260454 | |
| 4-naphthalen-2-yl phenylboronic acid, 4-2-naphthyl phenylboronic acid, 4-naphthalen-2-yl phenyl boronic acid, 4-2-naphthyl benzeneboronic acid, 4-naphthalen-2-yl phenylboronicacid, 4-2-naphthyl phenyl boronic acid, 4-naphthalen-1-yl-boronic acid, 4-naphth-1-yl benzeneboronic acid | |
| B(C1=CC=C(C=C1)C2=CC3=CC=CC=C3C=C2)(O)O | |
| 248.088 | |
| 248.09 |
| 918655-03-5 | |
| C16H13BO2 | |
| 1 g | |
| ICQAKBYFBIWELX-UHFFFAOYSA-N | |
| (4-naphthalen-2-ylphenyl)boronic acid | |
| 45382258 | |
| Crystalline Powder |
Chemical Identifiers
| 918655-03-5 | |
| 248.088 | |
| ICQAKBYFBIWELX-UHFFFAOYSA-N | |
| 45382258 | |
| B(C1=CC=C(C=C1)C2=CC3=CC=CC=C3C=C2)(O)O |
| C16H13BO2 | |
| MFCD09260454 | |
| 4-naphthalen-2-yl phenylboronic acid, 4-2-naphthyl phenylboronic acid, 4-naphthalen-2-yl phenyl boronic acid, 4-2-naphthyl benzeneboronic acid, 4-naphthalen-2-yl phenylboronicacid, 4-2-naphthyl phenyl boronic acid, 4-naphthalen-1-yl-boronic acid, 4-naphth-1-yl benzeneboronic acid | |
| (4-naphthalen-2-ylphenyl)boronic acid |
Safety and Handling
TSCA : No