missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
3-Iodo-L-tyrosine, 97%, ACROS Organics™
Manufacturer: Thermo Fisher Scientific 122440010
Specifications
| 3-Iodo-L-tyrosine | |
| 96.0 | |
| (1% aq. soln. at 40°C) clear, colorless | |
| 20ppm max. | |
| Authentic | |
| 15, 5090 | |
| Glass bottle | |
| C1=CC(=C(C=C1CC(C(=O)O)N)I)O | |
| 307.087 | |
| CHEBI:27847 | |
| − 3.18 | |
| Solubility in water: .. Other solubilities: soluble in 15 parts boiling water | |
| 1% max. (K.F.) | |
| 196.0°C to 198.0°C |
| 70-78-0 | |
| 100.0 | |
| 97% | |
| C9H10INO3 | |
| MFCD00002608 | |
| 3-iodo-4-hydroxyphenylalanine, 3-iodo-l-tyrosine, 3-iodo-tyrosine, 3-iodotyrosine, 3-monoiodo-l-tyrosine, h-tyr 3-i-oh, iodotyrosine, l-tyrosine, 3-iodo, monoiodotyrosine, s-2-amino-3-4-hydroxy-3-iodophenyl propanoic acid | |
| UQTZMGFTRHFAAM-ZETCQYMHSA-N | |
| (2S)-2-amino-3-(4-hydroxy-3-iodophenyl)propanoic acid | |
| 439744 | |
| 307.08 | |
| Powder | |
| 97% | |
| White | |
| 1g |
Chemical Identifiers
| 70-78-0 | |
| 307.087 | |
| UQTZMGFTRHFAAM-ZETCQYMHSA-N | |
| 439744 | |
| (2S)-2-amino-3-(4-hydroxy-3-iodophenyl)propanoic acid |
| C9H10INO3 | |
| MFCD00002608 | |
| 3-iodo-4-hydroxyphenylalanine, 3-iodo-l-tyrosine, 3-iodo-tyrosine, 3-iodotyrosine, 3-monoiodo-l-tyrosine, h-tyr 3-i-oh, iodotyrosine, l-tyrosine, 3-iodo, monoiodotyrosine, s-2-amino-3-4-hydroxy-3-iodophenyl propanoic acid | |
| CHEBI:27847 | |
| C1=CC(=C(C=C1CC(C(=O)O)N)I)O |