missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
3-Hydroxy-3,7,11-trimethyl-1,6,10-dodecatriene, 97+% (total alcohols), Thermo Scientific™
Supplier: Thermo Scientific Chemicals 121971000
Specifications
| 3-Hydroxy-3,7,11-trimethyl-1,6,10-dodecatriene | |
| 7212-44-4 | |
| 114.0°C (1.0 mmHg) | |
| Authentic | |
| C15H26O | |
| MFCD00008911,MFCD00008911,MFCD00008911,MFCD00085350 | |
| 0.87 | |
| 3r,6e-nerolidol, unii-uoc0644v25, 3r-6e-nerolidol, nerolidol, 3r,6e-3,7,11-trimethyldodeca-1,6,10-trien-3-ol, e-nerolidol, 1,6,10-dodecatrien-3-ol, 3,7,11-trimethyl-, 3r,6e, nerolidol, 6e--, --nerolidol, ?-nerolidol | |
| FQTLCLSUCSAZDY-SDNWHVSQNA-N | |
| (3R,6E)-3,7,11-trimethyldodeca-1,6,10-trien-3-ol | |
| 11241545 | |
| 222.37 |
| ≥97% (total alcohols) | |
| 0.8700g/mL | |
| 96°C | |
| Glass Bottle | |
| 1.4780 to 1.4830 | |
| 100g | |
| 15, 6561 | |
| Solubility in water: immiscible. Other solubilities: soluble in abs. alc. and fixed oils, (still clearly sol. in 3 parts of 70% alc.), insoluble in glycerol | |
| CC(C)=CCC\C(C)=C\CCC(C)(O)C=C | |
| 222.37 | |
| CHEBI:59959 | |
| 97+% (total alcohols) |
Chemical Identifiers
| 7212-44-4 | |
| 222.37 | |
| FQTLCLSUCSAZDY-SDNWHVSQNA-N | |
| 11241545 | |
| (3R,6E)-3,7,11-trimethyldodeca-1,6,10-trien-3-ol |
| C15H26O | |
| MFCD00008911,MFCD00008911,MFCD00008911,MFCD00085350 | |
| 3r,6e-nerolidol, unii-uoc0644v25, 3r-6e-nerolidol, nerolidol, 3r,6e-3,7,11-trimethyldodeca-1,6,10-trien-3-ol, e-nerolidol, 1,6,10-dodecatrien-3-ol, 3,7,11-trimethyl-, 3r,6e, nerolidol, 6e--, --nerolidol, ?-nerolidol | |
| CHEBI:59959 | |
| CC(C)=CCC\C(C)=C\CCC(C)(O)C=C |
Safety and Handling
GHS Signal Word: Warning
EINECSNumber : 230-597-5
RUO â Research Use Only