missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
3-Benzoylpyridine, 97%, ACROS Organics™
Chemical Identifiers
| CAS | 5424-19-1 |
|---|---|
| Molecular Formula | C12H9NO |
| Molecular Weight (g/mol) | 183.21 |
| MDL Number | MFCD00006394 |
| InChI Key | RYMBAPVTUHZCNF-UHFFFAOYSA-N |
| Synonym | 3-benzoyl pyridine, 3-benzoylpyridine, 3-pyridyl phenyl ketone, ketone, phenyl 3-pyridyl, methanone, phenyl-3-pyridinyl, phenyl 3-pyridinyl methanone, phenyl 3-pyridyl ketone, phenyl pyridin-3-yl methanone, phenyl-b-pyridyl ketone, pyridine, 3-benzoyl |
| PubChem CID | 21540 |
| IUPAC Name | phenyl(pyridin-3-yl)methanone |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CN=CC=C2 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC105811000
|
Thermo Fisher Scientific
105811000 |
100g | Glass bottle |
N/A
|
N/A | ||||
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
Chemical Identifiers
| 5424-19-1 | |
| 183.21 | |
| RYMBAPVTUHZCNF-UHFFFAOYSA-N | |
| 21540 | |
| C1=CC=C(C=C1)C(=O)C2=CN=CC=C2 |
| C12H9NO | |
| MFCD00006394 | |
| 3-benzoyl pyridine, 3-benzoylpyridine, 3-pyridyl phenyl ketone, ketone, phenyl 3-pyridyl, methanone, phenyl-3-pyridinyl, phenyl 3-pyridinyl methanone, phenyl 3-pyridyl ketone, phenyl pyridin-3-yl methanone, phenyl-b-pyridyl ketone, pyridine, 3-benzoyl | |
| phenyl(pyridin-3-yl)methanone |
Specifications
| 150°C | |
| Glass bottle | |
| White to Yellow | |
| 100g | |
| 96.0 | |
| 97% | |
| C6H5CO(C5H4N) | |
| 21,331 | |
| RYMBAPVTUHZCNF-UHFFFAOYSA-N | |
| phenyl(pyridin-3-yl)methanone | |
| 21540 | |
| Crystalline Solid | |
| 3-Benzoylpyridine, 97% |
| Authentic | |
| 307°C | |
| 36°C to 40°C | |
| 5424-19-1 | |
| 100.0 | |
| C12H9NO | |
| MFCD00006394 | |
| 3-benzoyl pyridine, 3-benzoylpyridine, 3-pyridyl phenyl ketone, ketone, phenyl 3-pyridyl, methanone, phenyl-3-pyridinyl, phenyl 3-pyridinyl methanone, phenyl 3-pyridyl ketone, phenyl pyridin-3-yl methanone, phenyl-b-pyridyl ketone, pyridine, 3-benzoyl | |
| C1=CC=C(C=C1)C(=O)C2=CN=CC=C2 | |
| 183.21 | |
| 183.21 | |
| 97% |
Safety and Handling
GHS H Statement
Causes skin irritation.
May cause respiratory irritation.
Causes serious eye irritation.
GHS P Statement
Avoid breathing dust/fume/gas/mist/vapors/spray.
IF ON SKIN: Wash with plenty of soap and water.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for
GHS Signal Word: Warning
EINECSNumber : 226-561-3
RTECSNumber : OB6401000
TSCA : TSCA