Learn More
3-Amino-2-naphthoic acid, 85%, tech., ACROS Organics™
$173.31 - $173.31
Chemical Identifiers
| CAS | 5959-52-4 |
|---|---|
| Molecular Formula | C11H9NO2 |
| Molecular Weight (g/mol) | 187.2 |
| MDL Number | MFCD00004115 |
| InChI Key | XFXOLBNQYFRSLQ-UHFFFAOYSA-N |
| Synonym | 2-amino-3-carboxynaphthalene |
| PubChem CID | 22244 |
| IUPAC Name | 3-aminonaphthalene-2-carboxylic acid |
| SMILES | C1=CC=C2C=C(C(=CC2=C1)C(=O)O)N |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
| AC104140050 SDS |
Acros Organics
104140050 |
5g | Glass bottle |
Each for $173.31
|
|
AC104140250 SDS |
Acros Organics
104140250 |
25g | Glass bottle | N/A | N/A |
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
Chemical Identifiers
| 5959-52-4 | |
| 187.2 | |
| XFXOLBNQYFRSLQ-UHFFFAOYSA-N | |
| 22244 | |
| C1=CC=C2C=C(C(=CC2=C1)C(=O)O)N |
| C11H9NO2 | |
| MFCD00004115 | |
| 2-amino-3-carboxynaphthalene | |
| 3-aminonaphthalene-2-carboxylic acid |
Specifications
| Authentic | |
| Green to Green-Yellow | |
| 5g | |
| 80.0 | |
| 85% | |
| H2NC10H6CO2H | |
| 14, 535 | |
| 2-amino-3-carboxynaphthalene | |
| C1=CC=C2C=C(C(=CC2=C1)C(=O)O)N | |
| 187.2 | |
| 187.2 | |
| 85% | |
| 3-Amino-2-naphthoic acid, 85% |
| Glass bottle | |
| 210.0°C | |
| 5959-52-4 | |
| 100.0 | |
| C11H9NO2 | |
| MFCD00004115 | |
| 15, 448 | |
| XFXOLBNQYFRSLQ-UHFFFAOYSA-N | |
| 3-aminonaphthalene-2-carboxylic acid | |
| 22244 | |
| Powder | |
| Technical |
Safety and Handling
GHS P Statement
Harmful if swallowed.
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification.
Warning
EINECSNumber : 227-726-2
RTECSNumber : QL1400000
TSCA : TSCA