Learn More
3,5-Dimethoxybenzoic acid, 97%, ACROS Organics™
Manufacturer: Thermo Fisher Scientific 115460250
Specifications
| 3, 5-Dimethoxybenzoic acid | |
| Glass bottle | |
| 182°C to 185°C | |
| 1132-21-4 | |
| 100.0 | |
| C9H10O4 | |
| 10, 405 | |
| Solubility in water: insoluble. Other solubilities: soluble in ethanol and ether | |
| COC1=CC(=CC(=C1)C(=O)O)OC | |
| 182.17 | |
| 182.17 | |
| ≥98.5% |
| Authentic | |
| Beige-Pink to White | |
| 25g | |
| 98.5 | |
| 99% | |
| (CH3O)2C6H3CO2H | |
| 3,5-dimethoxy benzoic acid | |
| IWPZKOJSYQZABD-UHFFFAOYSA-N | |
| 3,5-dimethoxybenzoic acid | |
| 14332 | |
| Crystalline Powder |
Chemical Identifiers
| 1132-21-4 | |
| 182.17 | |
| 3,5-dimethoxy benzoic acid | |
| 3,5-dimethoxybenzoic acid |
| C9H10O4 | |
| IWPZKOJSYQZABD-UHFFFAOYSA-N | |
| 14332 | |
| COC1=CC(=CC(=C1)C(=O)O)OC |
Safety and Handling
GHS H StatementCauses skin irritation.May cause respiratory irritation.May cause respiratory irritation.
GHS P StatementIf eye irritation persists: Get medical advice/attention.IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing.IF ON SKIN: Wash with plenty of soap and water.Wear protective gloves/protective clothing/eye protection/face protection.Call a POISON CENTER or doctor/physician if you feel unwell.If skin irritation occurs: Get medical advice/attention.
;GHS P StatementIf eye irritation persists: Get medical advice/attention.IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing.IF ON SKIN: Wash with plenty of soap and water.Wear protective gloves/protecti