missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
3,5-Bis(trifluoromethyl)benzyl Alcohol 98.0+%, TCI America™
Supplier: TCI America B17525G
Specifications
| 3,5-Bis(trifluoromethyl)benzyl Alcohol | |
| 55°C | |
| C9H6F6O | |
| 5 g | |
| BJTWPJOGDWRYDD-UHFFFAOYSA-N | |
| [3,5-bis(trifluoromethyl)phenyl]methanol | |
| 122933 | |
| ≥98.0% (GC) |
| 32707-89-4 | |
| White | |
| MFCD00009907 | |
| 3,5-bis trifluoromethyl benzyl alcohol, 3,5-bis trifluoromethyl phenyl methanol, 3,5-bis-trifluoromethyl-phenyl-methanol, 3,5-ditrifluoromethylbenzyl alcohol, benzenemethanol, 3,5-bis trifluoromethyl, 3,5-bis trifluoromethyl benzylalcohol, 3,5-di trifluoromethyl benzyl alcohol, 3,5-di trifluoromethyl phenyl methanol, 3,5-bis-trifluoromethyl benzyl alcohol | |
| C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)CO | |
| 244.136 | |
| 244.14 | |
| Crystalline Powder |
Chemical Identifiers
| 32707-89-4 | |
| 244.136 | |
| BJTWPJOGDWRYDD-UHFFFAOYSA-N | |
| 122933 | |
| C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)CO |
| C9H6F6O | |
| MFCD00009907 | |
| 3,5-bis trifluoromethyl benzyl alcohol, 3,5-bis trifluoromethyl phenyl methanol, 3,5-bis-trifluoromethyl-phenyl-methanol, 3,5-ditrifluoromethylbenzyl alcohol, benzenemethanol, 3,5-bis trifluoromethyl, 3,5-bis trifluoromethyl benzylalcohol, 3,5-di trifluoromethyl benzyl alcohol, 3,5-di trifluoromethyl phenyl methanol, 3,5-bis-trifluoromethyl benzyl alcohol | |
| [3,5-bis(trifluoromethyl)phenyl]methanol |
Safety and Handling
TSCA : No