missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
3,5-Bis(trifluoromethyl)benzoyl chloride, 97%, Thermo Scientific™
$91.44 - $472.18
Chemical Identifiers
| CAS | 785-56-8 |
|---|---|
| Molecular Formula | C9H3ClF6O |
| Molecular Weight (g/mol) | 276.562 |
| MDL Number | MFCD00000387 |
| InChI Key | WAKMMQSMEDJRRI-UHFFFAOYSA-N |
| Synonym | 3,5-bis trifluoromethyl benzoyl chloride, 3,5-bis-trifluoromethylbenzoyl chloride, 3,5-di trifluoromethyl benzoyl chloride, 3,5-bis trifluoromethyl benzoylchloride, benzoyl chloride, 3,5-bis trifluoromethyl, 3,5-bis-trifluoromethyl benzoyl chloride, benzoylchloride, 3,5-bis trifluoromethyl, fxffr cvg exfff, 3,5-bis trifluoromethyl benzoychloride |
| PubChem CID | 101856 |
| IUPAC Name | 3,5-bis(trifluoromethyl)benzoyl chloride |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)C(=O)Cl |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAA1140106
|
Thermo Scientific Chemicals
A1140106 |
5 g |
Each for $91.44
|
|
|||||
|
AAA1140114
|
Thermo Scientific Chemicals
A1140114 |
25 g |
Each for $472.18
|
|
|||||
Description
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 785-56-8 | |
| 276.562 | |
| WAKMMQSMEDJRRI-UHFFFAOYSA-N | |
| 101856 | |
| C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)C(=O)Cl |
| C9H3ClF6O | |
| MFCD00000387 | |
| 3,5-bis trifluoromethyl benzoyl chloride, 3,5-bis-trifluoromethylbenzoyl chloride, 3,5-di trifluoromethyl benzoyl chloride, 3,5-bis trifluoromethyl benzoylchloride, benzoyl chloride, 3,5-bis trifluoromethyl, 3,5-bis-trifluoromethyl benzoyl chloride, benzoylchloride, 3,5-bis trifluoromethyl, fxffr cvg exfff, 3,5-bis trifluoromethyl benzoychloride | |
| 3,5-bis(trifluoromethyl)benzoyl chloride |
Specifications
| 785-56-8 | |
| 65°C to 67°C (12 mmHg) | |
| C9H3ClF6O | |
| MFCD00000387 | |
| UN3265 | |
| Moisture sensitive | |
| WAKMMQSMEDJRRI-UHFFFAOYSA-N | |
| 3,5-bis(trifluoromethyl)benzoyl chloride | |
| 101856 | |
| 97% |
| 1.526 | |
| 72°C (161°F) | |
| 1.4332 | |
| 5 g | |
| 2593440 | |
| 3,5-bis trifluoromethyl benzoyl chloride, 3,5-bis-trifluoromethylbenzoyl chloride, 3,5-di trifluoromethyl benzoyl chloride, 3,5-bis trifluoromethyl benzoylchloride, benzoyl chloride, 3,5-bis trifluoromethyl, 3,5-bis-trifluoromethyl benzoyl chloride, benzoylchloride, 3,5-bis trifluoromethyl, fxffr cvg exfff, 3,5-bis trifluoromethyl benzoychloride | |
| C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)C(=O)Cl | |
| 276.562 | |
| 276.57 | |
| 3,5-Bis (trifluoromethyl)benzoyl chloride |
Safety and Handling
GHS H Statement
H314-H318-H227
Causes severe skin burns and eye damage.
Causes serious eye damage.
Combustible liquid.
P210-P260-P264b-P280-P301+P330+P331-P303+P361+P353-P304+P340-P305+P351+P338-P310-P363-P370+P378q-P501c
H227-H314
DOTInformation : Transport Hazard Class: 8; Packing Group: II; Proper Shipping Name: CORROSIVE LIQUID, ACIDIC, ORGANIC, N.O.S.
EINECSNumber : 212-322-0
TSCA : No
Recommended Storage : Ambient temperatures