Learn More
Alfa Aesar™ 3,4-Dimethoxybenzenesulfonyl chloride, 98%
Manufacturer: Alfa Aesar™ A1526322
Specifications
| 3,4-Dimethoxybenzenesulfonyl chloride | |
| 100g | |
| C8H9ClO4S | |
| UN3261 | |
| 3,4-dimethoxybenzene-1-sulfonyl chloride, 3,4-dimethoxybenzenesulfonylchloride, 3,4-dimethoxyphenylsulfonyl chloride, 3,4-dimethoxy benzenesulfonyl chloride, benzenesulfonyl chloride, 3,4-dimethoxy, 3,4-dimethoxyphenyl chlorosulfone, pubchem5127, acmc-1co88, asischem d48920, zerenex zx009571 | |
| COC1=C(C=C(C=C1)S(=O)(=O)Cl)OC | |
| 236.666 | |
| 236.68 |
| 66°C to 70°C | |
| 23095-31-0 | |
| MFCD00051769 | |
| 2840170 | |
| RSJSYCZYQNJQPY-UHFFFAOYSA-N | |
| 3,4-dimethoxybenzenesulfonyl chloride | |
| 2734183 | |
| 98% |
Chemical Identifiers
| 23095-31-0 | |
| 236.666 | |
| RSJSYCZYQNJQPY-UHFFFAOYSA-N | |
| 2734183 | |
| COC1=C(C=C(C=C1)S(=O)(=O)Cl)OC |
| C8H9ClO4S | |
| MFCD00051769 | |
| 3,4-dimethoxybenzene-1-sulfonyl chloride, 3,4-dimethoxybenzenesulfonylchloride, 3,4-dimethoxyphenylsulfonyl chloride, 3,4-dimethoxy benzenesulfonyl chloride, benzenesulfonyl chloride, 3,4-dimethoxy, 3,4-dimethoxyphenyl chlorosulfone, pubchem5127, acmc-1co88, asischem d48920, zerenex zx009571 | |
| 3,4-dimethoxybenzenesulfonyl chloride |
Safety and Handling
GHS H Statement
H314-H318
Causes severe skin burns and eye damage.
Causes serious eye damage.
GHS P Statement
P260-P303+P361+P353-P305+P351+P338-P301+P330+P331-P405-P501a
Do not breathe dust/fume/gas/mist/vapors/spray.
IF ON SKIN (or hair): Remove/Take off immediately all contaminated clothing. Rinse skin with water/shower.
IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.
IF SWALLOWED: Rinse mouth. Do NOT induce vomiting.
Store locked up.
Dispose of contents/container in accordance with local/regional/national/international regulations.
Danger
DOTInformation : Transport Hazard Class: 8; Packing Group: II; Proper Shipping Name: CORROSIVE SOLID, ACIDIC, ORGANIC, N.O.S.