missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
3,3'-Diaminobenzidine Tetrahydrochloride hydrate,97%, Contains Up to 10% Water, ACROS Organics™
Manufacturer: Acros Organics AC112090010
Specifications
| 3, 3'-Diaminobenzidine tetrahydrochloride hydrate | |
| 300.0°C | |
| 868272-85-9,868272-85-9 | |
| 100.0 | |
| 10% max. (120°C) | |
| Solubility in water: moderately soluble. Other solubilities: insoluble in most common organic solvents | |
| 97% | |
| 4HCl·xH2O | |
| 13, 340 | |
| WWIHRTPUMJFLTN-UHFFFAOYSA-N | |
| 4-(3,4-diaminophenyl)benzene-1,2-diamine;hydrate | |
| 23191111 | |
| Crystalline Powder |
| Brown-Purple to Gray | |
| 1g | |
| 96.0 | |
| Authentic | |
| Glass bottle | |
| 97% | |
| C12H16N4O | |
| MFCD08273058 | |
| 3,3',4,4'-Biphenyltetramine tetrahydrochloride hydrate, 3, 3', 4 | |
| C1=CC(=C(C=C1C2=CC(=C(C=C2)N)N)N)N.O | |
| 232.287 | |
| 360.11 |
Chemical Identifiers
| 868272-85-9 | |
| 232.287 | |
| WWIHRTPUMJFLTN-UHFFFAOYSA-N | |
| 23191111 | |
| C1=CC(=C(C=C1C2=CC(=C(C=C2)N)N)N)N.O |
| C12H16N4O | |
| MFCD08273058 | |
| 3,3',4,4'-Biphenyltetramine tetrahydrochloride hydrate, 3, 3', 4 | |
| 4-(3,4-diaminophenyl)benzene-1,2-diamine;hydrate |
Safety and Handling
GHS P Statement
May cause cancer.
Suspected of causing genetic defects.
GHS P Statement
Use personal protective equipment as required.
Obtain special instructions before use.
Do not handle until all safety precautions have been read and understood.
Danger
EINECSNumber : 231-018-9
RTECSNumber : DV8753000
TSCA : TSCA