missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
3,3,5-Trimethylcyclohexyl Mandelate (mixture of isomers) 94.0+%, TCI America™
Supplier: TCI America M082125G
Specifications
| 3,3,5-Trimethylcyclohexyl Mandelate (mixture of isomers) | |
| White | |
| MFCD00056623 | |
| Cyclandelate, Mandelic Acid 3,3,5-Trimethylcyclohexyl Ester | |
| CC1CC(CC(C)(C)C1)OC(=O)C(O)C1=CC=CC=C1 | |
| 276.38 | |
| CHEBI:3988 | |
| ≥94.0% (GC) |
| 456-59-7 | |
| C17H24O3 | |
| 25 g | |
| WZHCOOQXZCIUNC-UHFFFAOYNA-N | |
| 3,3,5-trimethylcyclohexyl 2-hydroxy-2-phenylacetate | |
| 2893 | |
| 276.38 | |
| Crystalline Powder |
Chemical Identifiers
| 456-59-7 | |
| 276.38 | |
| WZHCOOQXZCIUNC-UHFFFAOYNA-N | |
| 2893 | |
| 3,3,5-trimethylcyclohexyl 2-hydroxy-2-phenylacetate |
| C17H24O3 | |
| MFCD00056623 | |
| Cyclandelate, Mandelic Acid 3,3,5-Trimethylcyclohexyl Ester | |
| CHEBI:3988 | |
| CC1CC(CC(C)(C)C1)OC(=O)C(O)C1=CC=CC=C1 |
Safety and Handling
RTECSNumber : OO8200000
TSCA : Yes