missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
(2S)-(+)-Glycidyl tosylate, 99+%, ACROS Organics™
Manufacturer: Thermo Fisher Scientific AC264580250
Specifications
| (2S)-(+)-Glycidyl tosylate | |
| Authentic | |
| + 17.00 (20.00°C c=2.5,CHCl3) | |
| White | |
| 25g | |
| 99.0 | |
| 99% min. (GC) | |
| MFCD00064489 | |
| Solubility in water: decomposes. Other solubilities: soluble in chloroform | |
| CC1=CC=C(C=C1)S(=O)(=O)OCC2CO2 | |
| 228.27 | |
| 228.27 | |
| 99+% |
| >110°C | |
| Glass bottle | |
| + 17 | |
| 45°C to 48°C | |
| 70987-78-9 | |
| 100.0 | |
| C10H12O4S | |
| +-glycidyl tosylate, 2s-+-glycidyl tosylate, 2s-glycidyl tosylate, 2s-oxiran-2-ylmethyl 4-methylbenzenesulfonate, ccris 6400, oxiranemethanol, 4-methylbenzenesulfonate, s, s-+-glycidyl tosylate, s-glycidyl tosylate, s-glycidyltosylate, s-oxiran-2-ylmethyl 4-methylbenzenesulfonate | |
| NOQXXYIGRPAZJC-VIFPVBQESA-N | |
| [(2S)-oxiran-2-yl]methyl 4-methylbenzenesulfonate | |
| 153296 | |
| Fluffy Powder |
Chemical Identifiers
| 70987-78-9 | |
| 228.27 | |
| NOQXXYIGRPAZJC-VIFPVBQESA-N | |
| 153296 | |
| CC1=CC=C(C=C1)S(=O)(=O)OCC2CO2 |
| C10H12O4S | |
| MFCD00064489 | |
| +-glycidyl tosylate, 2s-+-glycidyl tosylate, 2s-glycidyl tosylate, 2s-oxiran-2-ylmethyl 4-methylbenzenesulfonate, ccris 6400, oxiranemethanol, 4-methylbenzenesulfonate, s, s-+-glycidyl tosylate, s-glycidyl tosylate, s-glycidyltosylate, s-oxiran-2-ylmethyl 4-methylbenzenesulfonate | |
| [(2S)-oxiran-2-yl]methyl 4-methylbenzenesulfonate |
Safety and Handling
GHS H Statement
May cause an allergic skin reaction.
Toxic to aquatic life with long lasting effects.
Causes serious eye damage.
Suspected of causing genetic defects.
May cause cancer.
GHS P Statement
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if present and easy to do.
Continue rinsing.
Immediately call a POISON CENTER or doctor/physician.
IF exposed or concerned: Get medi
GHS Signal Word: Danger