missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
2-Mercaptopyridine-N-oxide, sodium salt hydrate, 98%, ACROS Organics™
Manufacturer: Thermo Fisher Scientific 255380250
Specifications
| 2-Mercaptopyridine-N-oxide,sodium salt hydrate | |
| Glass bottle | |
| >260°C | |
| 98% | |
| 97.5 | |
| 98% | |
| MFCD00151244 | |
| sodium 2-mercaptopyridine n-oxide hydrate | |
| HTJXGDXCIFMYMU-UHFFFAOYSA-M | |
| sodium;1-oxidopyridin-1-ium-2-thiolate;hydrate | |
| 43835086 | |
| Granular Crystalline Powder |
| Authentic | |
| White to Yellow | |
| 25g | |
| 207511-13-5,3811-73-2 | |
| 100.0 | |
| C5H4NNaOS·xH2O | |
| 10, 7892 | |
| Solubility in water: soluble | |
| C1=CC=[N+](C(=C1)[S-])[O-].O.[Na+] | |
| 149.15 | |
| 149.15 | |
| 98% |
Chemical Identifiers
| 207511-13-5 | |
| 149.15 | |
| HTJXGDXCIFMYMU-UHFFFAOYSA-M | |
| 43835086 | |
| C1=CC=[N+](C(=C1)[S-])[O-].O.[Na+] |
| C5H4NNaOS·xH2O | |
| MFCD00151244 | |
| sodium 2-mercaptopyridine n-oxide hydrate | |
| sodium;1-oxidopyridin-1-ium-2-thiolate;hydrate |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Harmful in contact with skin.
Harmful if inhaled.
Causes skin irritation.
Causes serious eye irritation.
Very toxic to aquatic life with long lasting effects.
GHS P Statement
IF ON SKIN: Wash with plenty of soap and water.
Call a POISON CENTER or doctor/physician if you feel unwell.
GHS Signal Word: Warning
EINECSNumber : 223-296-5
RTECSNumber : UT9000000
TSCA : TSCA