missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Thermo Scientific Chemicals 2-Isopropoxy-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 359490050
Specifications
| 2-Isopropoxy-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | |
| 61676-62-8 | |
| 100.0 | |
| 0.9120g/mL | |
| 42°C | |
| 96% min. (GC) | |
| C9H19BO3 | |
| MFCD00192241 | |
| 0.912 | |
| MRWWWZLJWNIEEJ-UHFFFAOYSA-N | |
| 4,4,5,5-tetramethyl-2-propan-2-yloxy-1,3,2-dioxaborolane | |
| 5017741 | |
| 97% |
| 97% | |
| 96.0 | |
| Colorless | |
| 73°C (15.0mmHg) | |
| Authentic | |
| Glass bottle | |
| 1.4080 to 1.41 | |
| 5 g | |
| 2-isopropoxy-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, isopropoxyboronic acid pinacol ester, 4,4,5,5-tetramethyl-2-propan-2-yloxy-1,3,2-dioxaborolane, pinbop, isopropoxyboronic acid, pinacol ester, isopropyl pinacol borate, 2-iso-propoxy-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2-isopropoxy-4,4,5,5-tetramethyl-1,3,2 dioxaborolane, 2-isopropoxy-4,4,5,5-tetramethyl-1,3,2-dioxa-borolane, 2-isopropoxy-4,4,5,5-dimethyl-1,3,2-dioxaborolane | |
| B1(OC(C(O1)(C)C)(C)C)OC(C)C | |
| 186.06 | |
| 186.06 | |
| Liquid |
Chemical Identifiers
| 61676-62-8 | |
| 186.06 | |
| MRWWWZLJWNIEEJ-UHFFFAOYSA-N | |
| 5017741 | |
| B1(OC(C(O1)(C)C)(C)C)OC(C)C |
| C9H19BO3 | |
| MFCD00192241 | |
| 2-isopropoxy-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, isopropoxyboronic acid pinacol ester, 4,4,5,5-tetramethyl-2-propan-2-yloxy-1,3,2-dioxaborolane, pinbop, isopropoxyboronic acid, pinacol ester, isopropyl pinacol borate, 2-iso-propoxy-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2-isopropoxy-4,4,5,5-tetramethyl-1,3,2 dioxaborolane, 2-isopropoxy-4,4,5,5-tetramethyl-1,3,2-dioxa-borolane, 2-isopropoxy-4,4,5,5-dimethyl-1,3,2-dioxaborolane | |
| 4,4,5,5-tetramethyl-2-propan-2-yloxy-1,3,2-dioxaborolane |
Safety and Handling
GHS H Statement
Flammable liquid and vapour.
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
Avoid breathing dust/fume/gas/mist/vapors/spray.
IF ON SKIN: Wash with plenty of soap and water.
IF INHALED: Remove victim to fresh air and k
GHS Signal Word: Warning
Recommended Storage : Refrigerator +4°C
RUO â Research Use Only