Learn More
2-Hydroxy-p-naphthoquinone 99%, ACROS Organics™
Manufacturer: Acros Organics AC121630100
Specifications
| 2-Hydroxy-p-naphthoquinone | |
| Glass bottle | |
| 192.0°C to 195.0°C | |
| 99% | |
| 98.5 | |
| 99% | |
| MFCD00001678 | |
| 01,484 | |
| lawsone, 2-hydroxy-1,4-naphthoquinone, 2-hydroxynaphthalene-1,4-dione, 2-hydroxynaphthoquinone, henna, mehendi, hana, lawson, mendi, flower of paradise | |
| C1=CC=C2C(=C1)C(=CC(=O)C2=O)O | |
| 174.155 | |
| 174.16 | |
| 99% |
| Authentic | |
| Yellow | |
| 10g | |
| 83-72-7 | |
| 100.0 | |
| C10H6O3 | |
| 08, 300 | |
| 15, 5448 | |
| WVCHIGAIXREVNS-UHFFFAOYSA-N | |
| 4-hydroxynaphthalene-1,2-dione | |
| 6755 | |
| Crystalline Powder | |
| Pure |
Chemical Identifiers
| 83-72-7 | |
| 174.155 | |
| WVCHIGAIXREVNS-UHFFFAOYSA-N | |
| 6755 | |
| C1=CC=C2C(=C1)C(=CC(=O)C2=O)O |
| C10H6O3 | |
| MFCD00001678 | |
| lawsone, 2-hydroxy-1,4-naphthoquinone, 2-hydroxynaphthalene-1,4-dione, 2-hydroxynaphthoquinone, henna, mehendi, hana, lawson, mendi, flower of paradise | |
| 4-hydroxynaphthalene-1,2-dione |
Safety and Handling
GHS H Statement:
Suspected of causing genetic defects.
Causes serious eye irritation.
Harmful if swallowed.
GHS P Statement:
Wear protective gloves/eye protection/face protection.
Do not breathe dust/fume/gas/mist/vapors/spray.
IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification.
EINECSNumber : 201-496-3
RTECSNumber : QL8200000
TSCA : TSCA