Learn More
2-Ethyl-1,3-hexanediol, Mixture of Isomers 99%, ACROS Organics™
Manufacturer: Thermo Fisher Scientific 118512500
Specifications
| 2-Ethyl-1, 3-hexanediol | |
| 99% | |
| 98.5 | |
| 0.9422g/mL | |
| Glass bottle | |
| ≥98.5% | |
| C8H18O2 | |
| CH3CH2CH2CH(OH)CH(C2H5)CH2OH | |
| MFCD00004578 | |
| 15, 3797 | |
| Clear |
| 0.05mg KOH/g max. | |
| 94-96-2 | |
| 100.0 | |
| Authentic | |
| Liquid | |
| 99% | |
| 1.4495 to 1.4525 (20°C, 589nm) | |
| 146.23 | |
| 0.2% max. | |
| Ethohexadiol | |
| 250mL |
Chemical Identifiers
| 94-96-2 | |
| 100.0 | |
| C8H18O2 | |
| 146.23 | |
| Ethohexadiol | |
| ≥98.5% |
| 98.5 | |
| 99% | |
| CH3CH2CH2CH(OH)CH(C2H5)CH2OH | |
| MFCD00004578 | |
| 2-Ethyl-1, 3-hexanediol, 99% |
Safety and Handling
SDS & Safety Documents
GHS H Statement:
Causes serious eye damage.
GHS P Statement:
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.
Immediately call a POISON CENTER or doctor/physician.
WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification.
Danger
EINECSNumber : 202-377-9
RTECSNumber : MO2625000
TSCA : TSCA