missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
2-Di-tert-butylphosphino-2',4',6'-triisopropylbiphenyl, 97%, (patented by MIT Cambri, ACROS Organics™
Chemical Identifiers
| CAS | 564483-19-8 |
|---|---|
| Molecular Formula | C29H45P |
| Molecular Weight (g/mol) | 424.66 |
| MDL Number | MFCD06411306 |
| InChI Key | SACNIGZYDTUHKB-UHFFFAOYSA-N |
| Synonym | 2-di-t-butylphosphino-2',4',6'-tri-i-propyl-1,1'-biphenyl, 2-di-t-butylphosphino-2',4',6'-triisopropylbiphenyl, 2-di-tert-butylphosphino-2',4',6'-triisopropylbiphenyl, di-t-bu-xphos, di-tert-butyl 2',4',6'-triisopropyl-1,1'-biphenyl-2-yl phosphine, di-tert-butyl 2',4',6'-triisopropylbiphenyl-2-yl phosphine, t-bu xphos, t-butylxphos, tbuxphos, tert-butyl xphos |
| PubChem CID | 11618717 |
| IUPAC Name | ditert-butyl-[2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane |
| SMILES | CC(C)C1=CC(=C(C(=C1)C(C)C)C2=CC=CC=C2P(C(C)(C)C)C(C)(C)C)C(C)C |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC429840050
|
Thermo Fisher Scientific
AC429840050 |
5g | Glass bottle |
N/A
|
N/A | ||||
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
Chemical Identifiers
| 564483-19-8 | |
| 424.66 | |
| SACNIGZYDTUHKB-UHFFFAOYSA-N | |
| 11618717 | |
| CC(C)C1=CC(=C(C(=C1)C(C)C)C2=CC=CC=C2P(C(C)(C)C)C(C)(C)C)C(C)C |
| C29H45P | |
| MFCD06411306 | |
| 2-di-t-butylphosphino-2',4',6'-tri-i-propyl-1,1'-biphenyl, 2-di-t-butylphosphino-2',4',6'-triisopropylbiphenyl, 2-di-tert-butylphosphino-2',4',6'-triisopropylbiphenyl, di-t-bu-xphos, di-tert-butyl 2',4',6'-triisopropyl-1,1'-biphenyl-2-yl phosphine, di-tert-butyl 2',4',6'-triisopropylbiphenyl-2-yl phosphine, t-bu xphos, t-butylxphos, tbuxphos, tert-butyl xphos | |
| ditert-butyl-[2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane |
Specifications
| 79.15 to 84.90% C | |
| consistent with structure | |
| White | |
| 5g | |
| 96.0 | |
| 96% min. (HPLC) | |
| MFCD06411306 | |
| SACNIGZYDTUHKB-UHFFFAOYSA-N | |
| ditert-butyl-[2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane | |
| 11618717 | |
| Crystalline Powder | |
| 2-Di-tert-butylphosphino-2', 4', 6'-triisopropylbiphenyl |
| Authentic | |
| Glass bottle | |
| 148°C to 149°C | |
| 564483-19-8 | |
| 100.0 | |
| C29H45P | |
| 2-di-t-butylphosphino-2',4',6'-tri-i-propyl-1,1'-biphenyl, 2-di-t-butylphosphino-2',4',6'-triisopropylbiphenyl, 2-di-tert-butylphosphino-2',4',6'-triisopropylbiphenyl, di-t-bu-xphos, di-tert-butyl 2',4',6'-triisopropyl-1,1'-biphenyl-2-yl phosphine, di-tert-butyl 2',4',6'-triisopropylbiphenyl-2-yl phosphine, t-bu xphos, t-butylxphos, tbuxphos, tert-butyl xphos | |
| CC(C)C1=CC(=C(C(=C1)C(C)C)C2=CC=CC=C2P(C(C)(C)C)C(C)(C)C)C(C)C | |
| 424.66 | |
| 424.66 | |
| 97% |
Safety and Handling
GHS H Statement
May cause respiratory irritation.
Harmful if swallowed.
Causes skin irritation.
Causes serious eye irritation.
GHS P Statement
Avoid breathing dust/fume/gas/mist/vapors/spray.
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
IF ON SKIN: Wash with plenty of soap and water.
Wear protective gloves/protective clothing/e
GHS Signal Word: Warning