missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
2-Bromo-2',4'-difluoroacetophenone, 95%, ACROS Organics™
Manufacturer: Thermo Fisher Scientific AC442280050
Specifications
| 2-Bromo-2', 4'-difluoroacetophenone | |
| Authentic | |
| 31°C to 33°C | |
| 102429-07-2 | |
| 100.0 | |
| C8H5BrF2O | |
| CSGDTHXBRAAOHV-UHFFFAOYSA-N | |
| 2-bromo-1-(2,4-difluorophenyl)ethanone | |
| 2774185 | |
| Low Melting Solid |
| 51°C | |
| White | |
| 5g | |
| 94.0 | |
| 94% min. (GC) | |
| 2',4'-difluorophenacyl bromide, 2,4-difluorophenacyl bromide, 2-bromo-1-2,4-difluoro-phenyl-ethanone, 2-bromo-1-2,4-difluorophenyl ethan-1-one, 2-bromo-1-2,4-difluorophenyl ethanone, 2-bromo-2',4'-difluoroacetophenone, 2-bromo-2,4-difluoroacetophenone, acmc-1c4aw, alpha-bromo-2',4'-difluoroacetophenone, ethanone, 2-bromo-1-2,4-difluorophenyl | |
| C1=CC(=C(C=C1F)F)C(=O)CBr | |
| 235.03 | |
| 235.03 | |
| 95% |
Chemical Identifiers
| 102429-07-2 | |
| 235.03 | |
| 2',4'-difluorophenacyl bromide, 2,4-difluorophenacyl bromide, 2-bromo-1-2,4-difluoro-phenyl-ethanone, 2-bromo-1-2,4-difluorophenyl ethan-1-one, 2-bromo-1-2,4-difluorophenyl ethanone, 2-bromo-2',4'-difluoroacetophenone, 2-bromo-2,4-difluoroacetophenone, acmc-1c4aw, alpha-bromo-2',4'-difluoroacetophenone, ethanone, 2-bromo-1-2,4-difluorophenyl | |
| 2-bromo-1-(2,4-difluorophenyl)ethanone |
| C8H5BrF2O | |
| CSGDTHXBRAAOHV-UHFFFAOYSA-N | |
| 2774185 | |
| C1=CC(=C(C=C1F)F)C(=O)CBr |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Causes severe skin burns and eye damage.
Flammable solid.
GHS P Statement
Keep away from heat/sparks/open flames/hot surfaces.
- No smoking.
Wear protective gloves/protective clothing/eye protection/face protection.
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
Immediately call
GHS Signal Word: Danger