missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
2-Bromo-1-(4-morpholinophenyl)-1-ethanone, 97%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals CC17405CB
Specifications
| 2-Bromo-1-(4-morpholinophenyl)-1-ethanone | |
| 95% | |
| MFCD03783555 | |
| 2-bromo-1-4-morpholinophenyl-1-ethanone, 2-bromo-1-4-morpholinophenyl ethanone, 2-bromo-1-4-morpholin-4-ylphenyl ethanone, 2-bromo-1-4-4-morpholinyl phenyl ethanone, 2-bromo-1-4-morpholin-4-yl-phenyl ethanone, 2-bromo-1-4-morpholin-4-yl phenyl ethanone, 2-bromo-1-4-morpholin-4-ylphenyl ethan-1-one, pubchem23338, acmc-1cqxm, alpha-bromo-4'-morpholinoacetophenone | |
| BrCC(=O)C1=CC=C(C=C1)N1CCOCC1 | |
| 284.15 | |
| 284.15 |
| 210832-85-2 | |
| C12H14BrNO2 | |
| 250 mg | |
| OUGMZFJPRSTGMJ-UHFFFAOYSA-N | |
| 2-bromo-1-(4-morpholin-4-ylphenyl)ethanone | |
| 2795357 | |
| 95% |
Chemical Identifiers
| 210832-85-2 | |
| 284.15 | |
| OUGMZFJPRSTGMJ-UHFFFAOYSA-N | |
| 2795357 |
| C12H14BrNO2 | |
| MFCD03783555 | |
| 2-bromo-1-4-morpholinophenyl-1-ethanone, 2-bromo-1-4-morpholinophenyl ethanone, 2-bromo-1-4-morpholin-4-ylphenyl ethanone, 2-bromo-1-4-4-morpholinyl phenyl ethanone, 2-bromo-1-4-morpholin-4-yl-phenyl ethanone, 2-bromo-1-4-morpholin-4-yl phenyl ethanone, 2-bromo-1-4-morpholin-4-ylphenyl ethan-1-one, pubchem23338, acmc-1cqxm, alpha-bromo-4'-morpholinoacetophenone | |
| BrCC(=O)C1=CC=C(C=C1)N1CCOCC1 |