missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
2-Benzyl-2-(dimethylamino)-4'-morpholinobutyrophenone 98.0+%, TCI America™
Supplier: TCI America B391425G
Specifications
| 2-Benzyl-2-(dimethylamino)-4′-morpholinobutyrophenone | |
| 116°C | |
| C23H30N2O2 | |
| 25 g | |
| 2-Benzyl-2-(dimethylamino)-1-[4-(morpholino)phenyl]-1-butanone | |
| CCC(CC1=CC=CC=C1)(C(=O)C2=CC=C(C=C2)N3CCOCC3)N(C)C | |
| 366.505 | |
| 366.51 | |
| Crystalline Powder |
| 119313-12-1 | |
| Yellow | |
| MFCD00191775 | |
| 3077 | |
| UHFFVFAKEGKNAQ-UHFFFAOYSA-N | |
| 2-benzyl-2-(dimethylamino)-1-(4-morpholin-4-ylphenyl)butan-1-one | |
| 86171 | |
| ≥98.0% (HPLC,T) |
Chemical Identifiers
| 119313-12-1 | |
| 366.505 | |
| UHFFVFAKEGKNAQ-UHFFFAOYSA-N | |
| 86171 | |
| CCC(CC1=CC=CC=C1)(C(=O)C2=CC=C(C=C2)N3CCOCC3)N(C)C |
| C23H30N2O2 | |
| MFCD00191775 | |
| 2-Benzyl-2-(dimethylamino)-1-[4-(morpholino)phenyl]-1-butanone | |
| 2-benzyl-2-(dimethylamino)-1-(4-morpholin-4-ylphenyl)butan-1-one |
Safety and Handling
EINECSNumber : (5)-6310
RTECSNumber : EL7755000
TSCA : Yes