missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
2,7-Dihydroxynaphthalene, 97%, ACROS Organics™
Manufacturer: Thermo Fisher Scientific AC115045000
Specifications
| 2, 7-Dihydroxynaphthalene | |
| Glass bottle | |
| 184°C to 189°C | |
| 582-17-2 | |
| 100.0 | |
| C10H8O2 | |
| MFCD00004085 | |
| 2,7-dihdroxynaphthalene, 2,7-dihydroxy naphthalene, 2,7-dihydroxynaphthalene, 2,7-naphthalene diol, 2,7-naphthalenediol, naphthalene-2-7-diol, naphthalenediol-2,7, naphthalenediol-2,7 french, unii-0to8e448ud | |
| C1=CC(=CC2=C1C=CC(=C2)O)O | |
| 160.17 | |
| 160.17 | |
| 97% |
| Authentic | |
| Gray | |
| 500g | |
| 96.0 | |
| 96% min. (GC) | |
| C10H6(OH)2 | |
| 06, 985 | |
| DFQICHCWIIJABH-UHFFFAOYSA-N | |
| naphthalene-2,7-diol | |
| 11397 | |
| Powder |
Chemical Identifiers
| 582-17-2 | |
| 160.17 | |
| DFQICHCWIIJABH-UHFFFAOYSA-N | |
| 11397 | |
| C1=CC(=CC2=C1C=CC(=C2)O)O |
| C10H8O2 | |
| MFCD00004085 | |
| 2,7-dihdroxynaphthalene, 2,7-dihydroxy naphthalene, 2,7-dihydroxynaphthalene, 2,7-naphthalene diol, 2,7-naphthalenediol, naphthalene-2-7-diol, naphthalenediol-2,7, naphthalenediol-2,7 french, unii-0to8e448ud | |
| naphthalene-2,7-diol |
Safety and Handling
GHS H Statement
Causes skin irritation.
May cause respiratory irritation.
Causes serious eye irritation.
GHS P Statement
IF ON SKIN: Wash with plenty of soap and water.
If eye irritation persists: Get medical advice/attention.
IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing.
Call a POISON CENTER
GHS Signal Word: Warning
EINECSNumber : 209-478-7