missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
2,6-Diaminoheptanedioic acid, 95%, ACROS Organics™
Manufacturer: Fisher Scientific Acros 235540050
Specifications
| 2, 6-Diaminoheptanedioic acid | |
| Glass bottle | |
| 300°C | |
| 583-93-7 | |
| 100.0 | |
| C7H14N2O4 | |
| MFCD00002637 | |
| Solubility in water: 0.92% (21°C). Other solubilities: soluble in diluted acids and alkalies | |
| C(CC(C(=O)O)N)CC(C(=O)O)N | |
| 190.2 | |
| CHEBI:23673 | |
| Powder and/or Chunks |
| Authentic | |
| White to Beige | |
| 5g | |
| 95.0 | |
| 95% | |
| HOOCCH(NH2)3(CH2)3CH(NH2)COOH | |
| 1,5-diaminoheptanedioic acid, 2,6-diaminopimelic acid, d,l-diaminopimelate, diaminopimelic acid, dl-2,6-diaminoheptanedioic acid, dl-alpha,epsilon-diaminopimelic acid, heptanedioic acid, 2,6-diamino, ll-a2pm, ll-diaminopimelate, m-dap | |
| GMKMEZVLHJARHF-UHFFFAOYSA-N | |
| 2,6-diaminoheptanedioic acid | |
| 865 | |
| 190.2 | |
| 95% |
Chemical Identifiers
| 583-93-7 | |
| 190.2 | |
| GMKMEZVLHJARHF-UHFFFAOYSA-N | |
| 865 | |
| 2,6-diaminoheptanedioic acid |
| C7H14N2O4 | |
| MFCD00002637 | |
| 1,5-diaminoheptanedioic acid, 2,6-diaminopimelic acid, d,l-diaminopimelate, diaminopimelic acid, dl-2,6-diaminoheptanedioic acid, dl-alpha,epsilon-diaminopimelic acid, heptanedioic acid, 2,6-diamino, ll-a2pm, ll-diaminopimelate, m-dap | |
| CHEBI:23673 | |
| C(CC(C(=O)O)N)CC(C(=O)O)N |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if present and easy to do.
Continue rinsing.
GHS Signal Word: Warning
EINECSNumber : 209-524-6